Difference between revisions of "PWY-7117"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17370 CPD-17370] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCCCCCCCCO)COP(=O...")
 
(Created page with "Category:Gene == Gene Ec-00_000940 == * left end position: ** 1239799 * transcription direction: ** NEGATIVE * right end position: ** 1247358 * centisome position: ** 6.54...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17370 CPD-17370] ==
+
== Gene Ec-00_000940 ==
−
* smiles:
+
* left end position:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCCCCCCCCO)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 1239799
−
* inchi key:
+
* transcription direction:
−
** InChIKey=MQACSUXWIYYZAK-UTNXWDCOSA-J
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 18-hydroxyoleoyl-CoA
+
** 1247358
−
* molecular weight:
+
* centisome position:
−
** 1043.952    
+
** 6.543707    
 
* Synonym(s):
 
* Synonym(s):
−
** (9Z)-18-hydroxyoctadec-9-enoyl-CoA
+
** Esi_0013_0010
−
** ω-hydroxyoleoyl-CoA
+
** Esi0013_0010
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-16117]]
+
* [[ACID-PHOSPHATASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** esiliculosus_genome
−
* [[RXN-16402]]
+
***go-term
−
== Reaction(s) of unknown directionality ==
+
* [[RXN-5822]]
 +
** esiliculosus_genome
 +
***go-term
 +
== Pathways associated ==
 +
* [[PWY-6348]]
 +
* [[PWY-5083]]
 +
* [[NADPHOS-DEPHOS-PWY]]
 +
* [[NAD-BIOSYNTHESIS-II]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=1239799}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820566 91820566]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=1247358}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=86044 86044]
+
{{#set: centisome position=6.543707   }}
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCCCCCCCCO)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: common name=Esi_0013_0010|Esi0013_0010}}
−
{{#set: inchi key=InChIKey=MQACSUXWIYYZAK-UTNXWDCOSA-J}}
+
{{#set: reaction associated=ACID-PHOSPHATASE-RXN|RXN-5822}}
−
{{#set: common name=18-hydroxyoleoyl-CoA}}
+
{{#set: pathway associated=PWY-6348|PWY-5083|NADPHOS-DEPHOS-PWY|NAD-BIOSYNTHESIS-II}}
−
{{#set: molecular weight=1043.952   }}
+
−
{{#set: common name=(9Z)-18-hydroxyoctadec-9-enoyl-CoA|ω-hydroxyoleoyl-CoA}}
+
−
{{#set: consumed by=RXN-16117}}
+
−
{{#set: produced by=RXN-16402}}
+

Revision as of 21:13, 17 March 2018

Gene Ec-00_000940

  • left end position:
    • 1239799
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 1247358
  • centisome position:
    • 6.543707
  • Synonym(s):
    • Esi_0013_0010
    • Esi0013_0010

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-7117&oldid=12154"