Difference between revisions of "PWY-5514"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17813 CPD-17813] == * smiles: ** CCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=...")
 
(Created page with "Category:Gene == Gene Ec-01_003540 == * left end position: ** 2987192 * transcription direction: ** NEGATIVE * right end position: ** 2993183 * centisome position: ** 28.9...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17813 CPD-17813] ==
+
== Gene Ec-01_003540 ==
−
* smiles:
+
* left end position:
−
** CCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O
+
** 2987192
−
* inchi key:
+
* transcription direction:
−
** InChIKey=AMSSMXHTRODKSM-FYYFNCOUSA-J
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** (2E,11Z)-hexadec-2,11-dienoyl-CoA
+
** 2993183
−
* molecular weight:
+
* centisome position:
−
** 997.883    
+
** 28.94893    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0003_0273
 +
** Esi0003_0273
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-16558]]
+
* [[ATPASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** esiliculosus_genome
−
== Reaction(s) of unknown directionality ==
+
***go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=2987192}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819958 91819958]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=CCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O}}
+
{{#set: right end position=2993183}}
−
{{#set: inchi key=InChIKey=AMSSMXHTRODKSM-FYYFNCOUSA-J}}
+
{{#set: centisome position=28.94893    }}
−
{{#set: common name=(2E,11Z)-hexadec-2,11-dienoyl-CoA}}
+
{{#set: common name=Esi_0003_0273|Esi0003_0273}}
−
{{#set: molecular weight=997.883    }}
+
{{#set: reaction associated=ATPASE-RXN}}
−
{{#set: consumed by=RXN-16558}}
+

Revision as of 21:14, 17 March 2018

Gene Ec-01_003540

  • left end position:
    • 2987192
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 2993183
  • centisome position:
    • 28.94893
  • Synonym(s):
    • Esi_0003_0273
    • Esi0003_0273

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-5514&oldid=12178"