Difference between revisions of "Ec-21 005910"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17814 CPD-17814] == * smiles: ** CCCCC=CCCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(...")
 
(Created page with "Category:Gene == Gene Ec-21_005020 == * left end position: ** 5968402 * transcription direction: ** POSITIVE * right end position: ** 5972285 * centisome position: ** 80.8...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17814 CPD-17814] ==
+
== Gene Ec-21_005020 ==
−
* smiles:
+
* left end position:
−
** CCCCC=CCCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O
+
** 5968402
−
* inchi key:
+
* transcription direction:
−
** InChIKey=SHGDVNGLFXVIAK-BFVORPHASA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** (11Z)-(S)-3-hydroxyhexadec-11-enoyl-CoA
+
** 5972285
−
* molecular weight:
+
* centisome position:
−
** 1015.898    
+
** 80.87135    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0155_0039
 +
** Esi0155_0039
 +
** COX6b
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-16559]]
+
* [[CYTOCHROME-C-OXIDASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** esiliculosus_genome
−
* [[RXN-16558]]
+
***go-term
−
== Reaction(s) of unknown directionality ==
+
* [[RXN-15830]]
 +
** esiliculosus_genome
 +
***go-term
 +
== Pathways associated ==
 +
* [[PWY-6692]]
 +
* [[PWY-7279]]
 +
* [[PWY-3781]]
 +
* [[PWY-4521]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=5968402}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820456 91820456]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=CCCCC=CCCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O}}
+
{{#set: right end position=5972285}}
−
{{#set: inchi key=InChIKey=SHGDVNGLFXVIAK-BFVORPHASA-J}}
+
{{#set: centisome position=80.87135    }}
−
{{#set: common name=(11Z)-(S)-3-hydroxyhexadec-11-enoyl-CoA}}
+
{{#set: common name=Esi_0155_0039|Esi0155_0039|COX6b}}
−
{{#set: molecular weight=1015.898    }}
+
{{#set: reaction associated=CYTOCHROME-C-OXIDASE-RXN|RXN-15830}}
−
{{#set: consumed by=RXN-16559}}
+
{{#set: pathway associated=PWY-6692|PWY-7279|PWY-3781|PWY-4521}}
−
{{#set: produced by=RXN-16558}}
+

Revision as of 21:16, 17 March 2018

Gene Ec-21_005020

  • left end position:
    • 5968402
  • transcription direction:
    • POSITIVE
  • right end position:
    • 5972285
  • centisome position:
    • 80.87135
  • Synonym(s):
    • Esi_0155_0039
    • Esi0155_0039
    • COX6b

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-21_005910&oldid=12312"