Difference between revisions of "GLYSYN-ALA-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-18_002500 == * left end position: ** 2395158 * transcription direction: ** NEGATIVE * right end position: ** 2400126 * centisome position: ** 48.6...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-700 CPD-700] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-18_002500 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-700 CPD-700] ==
−
* left end position:
+
* smiles:
−
** 2395158
+
** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
−
* transcription direction:
+
* inchi key:
−
** NEGATIVE
+
** InChIKey=ZEPNVCGPJXYABB-LOIOQLKMSA-N
−
* right end position:
+
* common name:
−
** 2400126
+
** ergosta-5,7,24(28)-trien-3β-ol
−
* centisome position:
+
* molecular weight:
−
** 48.61728    
+
** 396.655    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0053_0108
+
** 5,7,24(28)-ergostatrienol
−
** Esi0053_0108
+
** 5-dehydro episterol
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[HISTONE-ACETYLTRANSFERASE-RXN]]
+
* [[RXN-707]]
−
** esiliculosus_genome
+
== Reaction(s) known to produce the compound ==
−
***go-term
+
* [[RXN3O-218]]
−
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=2395158}}
+
* LIGAND-CPD:
−
{{#set: transcription direction=NEGATIVE}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C15780 C15780]
−
{{#set: right end position=2400126}}
+
* HMDB : HMDB06848
−
{{#set: centisome position=48.61728   }}
+
* CHEBI:
−
{{#set: common name=Esi_0053_0108|Esi0053_0108}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=52972 52972]
−
{{#set: reaction associated=HISTONE-ACETYLTRANSFERASE-RXN}}
+
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=10894570 10894570]
 +
{{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
 +
{{#set: inchi key=InChIKey=ZEPNVCGPJXYABB-LOIOQLKMSA-N}}
 +
{{#set: common name=ergosta-5,7,24(28)-trien-3β-ol}}
 +
{{#set: molecular weight=396.655   }}
 +
{{#set: common name=5,7,24(28)-ergostatrienol|5-dehydro episterol}}
 +
{{#set: consumed by=RXN-707}}
 +
{{#set: produced by=RXN3O-218}}

Revision as of 21:27, 17 March 2018

Metabolite CPD-700

  • smiles:
    • CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • inchi key:
    • InChIKey=ZEPNVCGPJXYABB-LOIOQLKMSA-N
  • common name:
    • ergosta-5,7,24(28)-trien-3β-ol
  • molecular weight:
    • 396.655
  • Synonym(s):
    • 5,7,24(28)-ergostatrienol
    • 5-dehydro episterol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=GLYSYN-ALA-PWY&oldid=8974"