Difference between revisions of "RXN-12978"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CIT CIT] == * smiles: ** C(=O)([O-])CC(C(=O)[O-])(O)CC(=O)[O-] * inchi key: ** InChIKey=KRKNYBC...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OCTAPRENYL-METHYL-METHOXY-BENZQ OCTAPRENYL-METHYL-METHOXY-BENZQ] == * smiles: ** CC(=CCCC(=CCCC...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OCTAPRENYL-METHYL-METHOXY-BENZQ OCTAPRENYL-METHYL-METHOXY-BENZQ] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(OC)=CC(=C1C)O)O))C)C)C)C)C)C)C)C |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=HDSGDGSLNMIMKU-KFSSTAEESA-N |
* common name: | * common name: | ||
− | ** | + | ** 6-methoxy-3-methyl-2-all-trans-octaprenyl-1,4-benzoquinol |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 699.111 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 2-octaprenyl-3-methyl-6-methoxy-1,4-benzenediol |
− | ** | + | ** 6-methoxy-3-methyl-2-octaprenylquinol |
− | ** | + | ** 2-octaprenyl-3-methyl-6-methoxyhydroquinone |
− | ** 2- | + | ** 2-octaprenyl-3-methyl-6-methoxyquinol |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[2-OCTAPRENYL-METHOXY-BENZOQ-METH-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
− | |||
== External links == | == External links == | ||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49852330 49852330] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60656 60656] |
− | * | + | * BIGG : 1446539 |
− | {{#set: smiles= | + | {{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(OC)=CC(=C1C)O)O))C)C)C)C)C)C)C)C}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=HDSGDGSLNMIMKU-KFSSTAEESA-N}} |
− | {{#set: common name= | + | {{#set: common name=6-methoxy-3-methyl-2-all-trans-octaprenyl-1,4-benzoquinol}} |
− | {{#set: molecular weight= | + | {{#set: molecular weight=699.111 }} |
− | {{#set: common name= | + | {{#set: common name=2-octaprenyl-3-methyl-6-methoxy-1,4-benzenediol|6-methoxy-3-methyl-2-octaprenylquinol|2-octaprenyl-3-methyl-6-methoxyhydroquinone|2-octaprenyl-3-methyl-6-methoxyquinol}} |
− | + | {{#set: produced by=2-OCTAPRENYL-METHOXY-BENZOQ-METH-RXN}} | |
− | + | ||
− | {{#set: | + |
Revision as of 22:16, 17 March 2018
Contents
Metabolite OCTAPRENYL-METHYL-METHOXY-BENZQ
- smiles:
- CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(OC)=CC(=C1C)O)O))C)C)C)C)C)C)C)C
- inchi key:
- InChIKey=HDSGDGSLNMIMKU-KFSSTAEESA-N
- common name:
- 6-methoxy-3-methyl-2-all-trans-octaprenyl-1,4-benzoquinol
- molecular weight:
- 699.111
- Synonym(s):
- 2-octaprenyl-3-methyl-6-methoxy-1,4-benzenediol
- 6-methoxy-3-methyl-2-octaprenylquinol
- 2-octaprenyl-3-methyl-6-methoxyhydroquinone
- 2-octaprenyl-3-methyl-6-methoxyquinol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links