Difference between revisions of "PREPHENATE-DEHYDROGENASE-NADP+-RXN"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-22_000080 == * left end position: ** 101833 * transcription direction: ** NEGATIVE * right end position: ** 111058 * centisome position: ** 2.2550...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14675 CPD-14675] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14675 CPD-14675] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)CCCC(C)CCCC(C)CCCC(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=XYJPSQPVCBNZHT-TUKYSRJDSA-J |
− | * | + | * common name: |
− | ** | + | ** pristanoyl-CoA |
− | * | + | * molecular weight: |
− | ** | + | ** 1043.995 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 2,6,10,14-tetramethylpentadecanoyl-CoA |
− | ** | + | ** 2,6,10,14-tetramethylpentadecanoyl-coenzyme A |
− | ** | + | ** pristanoyl-coenzyme A |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN66-484]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | |
− | * [[ | + | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289196 86289196] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77250 77250] |
− | {{#set: common name= | + | {{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
− | + | {{#set: inchi key=InChIKey=XYJPSQPVCBNZHT-TUKYSRJDSA-J}} | |
− | {{#set: | + | {{#set: common name=pristanoyl-CoA}} |
+ | {{#set: molecular weight=1043.995 }} | ||
+ | {{#set: common name=2,6,10,14-tetramethylpentadecanoyl-CoA|2,6,10,14-tetramethylpentadecanoyl-coenzyme A|pristanoyl-coenzyme A}} | ||
+ | {{#set: produced by=RXN66-484}} |
Revision as of 21:16, 17 March 2018
Contents
Metabolite CPD-14675
- smiles:
- CC(C)CCCC(C)CCCC(C)CCCC(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=XYJPSQPVCBNZHT-TUKYSRJDSA-J
- common name:
- pristanoyl-CoA
- molecular weight:
- 1043.995
- Synonym(s):
- 2,6,10,14-tetramethylpentadecanoyl-CoA
- 2,6,10,14-tetramethylpentadecanoyl-coenzyme A
- pristanoyl-coenzyme A
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)CCCC(C)CCCC(C)CCCC(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.