Difference between revisions of "Ec-12 005460"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-06_000980 == * left end position: ** 653832 * transcription direction: ** NEGATIVE * right end position: ** 654080 * centisome position: ** 7.4657...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-SELENOCYSTEINE L-SELENOCYSTEINE] == * smiles: ** C([Se])C([N+])C([O-])=O * inchi key: ** InCh...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-SELENOCYSTEINE L-SELENOCYSTEINE] == |
− | * | + | * smiles: |
− | ** | + | ** C([Se])C([N+])C([O-])=O |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=ZKZBPNGNEQAJSX-REOHCLBHSA-N |
− | * | + | * common name: |
− | ** | + | ** L-selenocysteine |
− | * | + | * molecular weight: |
− | ** | + | ** 168.054 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** U |
− | + | ||
− | + | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-12726]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05688 C05688] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57843 57843] |
− | {{#set: common name= | + | * METABOLIGHTS : MTBLC57843 |
− | {{#set: | + | * PUBCHEM: |
− | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245418 25245418] | |
+ | * HMDB : HMDB03288 | ||
+ | {{#set: smiles=C([Se])C([N+])C([O-])=O}} | ||
+ | {{#set: inchi key=InChIKey=ZKZBPNGNEQAJSX-REOHCLBHSA-N}} | ||
+ | {{#set: common name=L-selenocysteine}} | ||
+ | {{#set: molecular weight=168.054 }} | ||
+ | {{#set: common name=U}} | ||
+ | {{#set: produced by=RXN-12726}} |
Revision as of 21:17, 17 March 2018
Contents
Metabolite L-SELENOCYSTEINE
- smiles:
- C([Se])C([N+])C([O-])=O
- inchi key:
- InChIKey=ZKZBPNGNEQAJSX-REOHCLBHSA-N
- common name:
- L-selenocysteine
- molecular weight:
- 168.054
- Synonym(s):
- U
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([Se])C([N+])C([O-])=O" cannot be used as a page name in this wiki.