Difference between revisions of "RXN-17475"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11523 CPD-11523] == * smiles: ** CCC=CCC4(C(=O)CCC(CCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)CO...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=GLYOXDEG-PWY GLYOXDEG-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 T...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11523 CPD-11523] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=GLYOXDEG-PWY GLYOXDEG-PWY] ==
* smiles:
+
* taxonomic range:
** CCC=CCC4(C(=O)CCC(CCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** InChIKey=OMDQVIUYDJAWHX-ZMWLRFEFSA-J
+
 
* common name:
 
* common name:
** OPC6-3-hydroxyacyl-CoA
+
** glycolate and glyoxylate degradation II
* molecular weight:
+
** 1027.866   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** glyoxylate degradation
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-10702]]
+
'''1''' reactions found over '''2''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[MALSYN-RXN]]
* [[RXN-10704]]
+
** 1 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Ec-12_003860]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=GLYCOLATEDEHYDRO-RXN GLYCOLATEDEHYDRO-RXN]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ECOCYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237226 44237226]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=GLYOXDEG-PWY GLYOXDEG-PWY]
{{#set: smiles=CCC=CCC4(C(=O)CCC(CCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)}}
+
{{#set: taxonomic range=TAX-2}}
{{#set: inchi key=InChIKey=OMDQVIUYDJAWHX-ZMWLRFEFSA-J}}
+
{{#set: common name=glycolate and glyoxylate degradation II}}
{{#set: common name=OPC6-3-hydroxyacyl-CoA}}
+
{{#set: common name=glyoxylate degradation}}
{{#set: molecular weight=1027.866    }}
+
{{#set: reaction found=1}}
{{#set: consumed by=RXN-10702}}
+
{{#set: total reaction=2}}
{{#set: produced by=RXN-10704}}
+
{{#set: completion rate=50.0}}

Revision as of 21:17, 17 March 2018

Pathway GLYOXDEG-PWY

  • taxonomic range:
  • common name:
    • glycolate and glyoxylate degradation II
  • Synonym(s):
    • glyoxylate degradation

Reaction(s) found

1 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links