Difference between revisions of "ALACAT2-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-700 CPD-700] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C...")
 
(Created page with "Category:Gene == Gene Ec-22_000810 == * left end position: ** 948281 * transcription direction: ** POSITIVE * right end position: ** 960911 * centisome position: ** 20.998...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-700 CPD-700] ==
+
== Gene Ec-22_000810 ==
−
* smiles:
+
* left end position:
−
** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
** 948281
−
* inchi key:
+
* transcription direction:
−
** InChIKey=ZEPNVCGPJXYABB-LOIOQLKMSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** ergosta-5,7,24(28)-trien-3β-ol
+
** 960911
−
* molecular weight:
+
* centisome position:
−
** 396.655    
+
** 20.998943    
 
* Synonym(s):
 
* Synonym(s):
−
** 5,7,24(28)-ergostatrienol
+
** Esi_0065_0090
−
** 5-dehydro episterol
+
** Esi0065_0090
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-707]]
+
* [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** esiliculosus_genome
−
* [[RXN3O-218]]
+
***go-term
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[UDPNACETYLGALSYN-PWY]]
 +
* [[PWY-6749]]
 +
* [[UDPNAGSYN-PWY]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: left end position=948281}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15780 C15780]
+
{{#set: transcription direction=POSITIVE}}
−
* HMDB : HMDB06848
+
{{#set: right end position=960911}}
−
* CHEBI:
+
{{#set: centisome position=20.998943   }}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=52972 52972]
+
{{#set: common name=Esi_0065_0090|Esi0065_0090}}
−
* PUBCHEM:
+
{{#set: reaction associated=L-GLN-FRUCT-6-P-AMINOTRANS-RXN}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=10894570 10894570]
+
{{#set: pathway associated=UDPNACETYLGALSYN-PWY|PWY-6749|UDPNAGSYN-PWY}}
−
{{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
−
{{#set: inchi key=InChIKey=ZEPNVCGPJXYABB-LOIOQLKMSA-N}}
+
−
{{#set: common name=ergosta-5,7,24(28)-trien-3β-ol}}
+
−
{{#set: molecular weight=396.655   }}
+
−
{{#set: common name=5,7,24(28)-ergostatrienol|5-dehydro episterol}}
+
−
{{#set: consumed by=RXN-707}}
+
−
{{#set: produced by=RXN3O-218}}
+

Revision as of 20:27, 17 March 2018

Gene Ec-22_000810

  • left end position:
    • 948281
  • transcription direction:
    • POSITIVE
  • right end position:
    • 960911
  • centisome position:
    • 20.998943
  • Synonym(s):
    • Esi_0065_0090
    • Esi0065_0090

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=ALACAT2-PWY&oldid=8990"