Difference between revisions of "PWY-6531"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-METHYL-MYO-INOSITOL 4-METHYL-MYO-INOSITOL] == * smiles: ** COC1(C(O)C(O)C(O)C(O)C(O)1) * inch...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7579 PWY-7579] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-11...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7579 PWY-7579] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-1117] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** phycourobilin biosynthesis |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[RXN- | + | '''1''' reactions found over '''5''' reactions in the full pathway |
| − | == Reaction(s) | + | * [[1.3.7.3-RXN]] |
| − | == | + | ** 1 associated gene(s): |
| + | *** [[Ec-22_000060]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=1.3.7.2-RXN 1.3.7.2-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-15985 RXN-15985] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-15990 RXN-15990] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-17523 RXN-17523] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-1117}} | |
| − | + | {{#set: common name=phycourobilin biosynthesis}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=5}} | |
| − | + | {{#set: completion rate=20.0}} | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 21:19, 17 March 2018
Pathway PWY-7579
- taxonomic range:
- common name:
- phycourobilin biosynthesis
- Synonym(s):
Reaction(s) found
1 reactions found over 5 reactions in the full pathway
- 1.3.7.3-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
