Difference between revisions of "DEOXYRIBODIPYRIMIDINE-PHOTOLYASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-488 CPD-488] == * smiles: ** CC1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1) * inchi key: ** InChIKe...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-381 PWY-381] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-330...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-488 CPD-488] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-381 PWY-381] ==
−
* smiles:
+
* taxonomic range:
−
** CC1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2763 TAX-2763]
−
** InChIKey=PTVXQARCLQPGIR-SXUWKVJYSA-L
+
 
* common name:
 
* common name:
−
** β-L-fucose 1-phosphate
+
** nitrate reduction II (assimilatory)
−
* molecular weight:
+
−
** 242.122   
+
 
* Synonym(s):
 
* Synonym(s):
−
** L-Fucose 1-phosphate
+
** nitrate assimilation
−
** 6-deoxy-L-galactose 1-phosphate
+
−
** L-fucopyranose 1-(dihydrogen phosphate)
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[2.7.7.30-RXN]]
+
'''3''' reactions found over '''3''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[FERREDOXIN--NITRITE-REDUCTASE-RXN]]
−
* [[FUCOKINASE-RXN]]
+
** 1 associated gene(s):
−
== Reaction(s) of unknown directionality ==
+
*** [[Ec-01_002720]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-aragem]]
 +
* [[GLUTAMINESYN-RXN]]
 +
** 4 associated gene(s):
 +
*** [[Ec-15_004110]]
 +
*** [[Ec-21_003610]]
 +
*** [[Ec-09_000640]]
 +
*** [[Ec-15_004120]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[NITRATE-REDUCTASE-NADH-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-10_005740]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-33090}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266535 45266535]
+
{{#set: taxonomic range=TAX-2763}}
−
* CHEBI:
+
{{#set: common name=nitrate reduction II (assimilatory)}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57268 57268]
+
{{#set: common name=nitrate assimilation}}
−
* LIGAND-CPD:
+
{{#set: reaction found=3}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02985 C02985]
+
{{#set: total reaction=3}}
−
* HMDB : HMDB01265
+
{{#set: completion rate=100.0}}
−
{{#set: smiles=CC1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1)}}
+
−
{{#set: inchi key=InChIKey=PTVXQARCLQPGIR-SXUWKVJYSA-L}}
+
−
{{#set: common name=β-L-fucose 1-phosphate}}
+
−
{{#set: molecular weight=242.122    }}
+
−
{{#set: common name=L-Fucose 1-phosphate|6-deoxy-L-galactose 1-phosphate|L-fucopyranose 1-(dihydrogen phosphate)}}
+
−
{{#set: consumed by=2.7.7.30-RXN}}
+
−
{{#set: produced by=FUCOKINASE-RXN}}
+

Revision as of 20:27, 17 March 2018

Pathway PWY-381

  • taxonomic range:
  • common name:
    • nitrate reduction II (assimilatory)
  • Synonym(s):
    • nitrate assimilation

Reaction(s) found

3 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=DEOXYRIBODIPYRIMIDINE-PHOTOLYASE-RXN&oldid=9004"