Difference between revisions of "CPD0-1133"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6992 CPD-6992] == * smiles: ** C3(C=CC(C2(OC1(=CC(=CC(=C1C(C2O)=O)O)[O-])))=CC=3) * inchi k...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-476 RXN66-476] == * direction: ** LEFT-TO-RIGHT * common name: ** fatty aldehyde dehydrogenas...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-476 RXN66-476] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** fatty aldehyde dehydrogenase |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/1.2.1.3 EC-1.2.1.3] |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | == | + | * With identifiers: |
| − | * [[ | + | ** 1 [[NAD]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[Odd-Straight-Chain-234-Sat-FALD]][c] '''=>''' 2 [[PROTON]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[Odd-Straight-Chain-234-Sat-FA]][c] |
| − | == | + | * With common name(s): |
| + | ** 1 NAD+[c] '''+''' 1 H2O[c] '''+''' 1 an odd numbered straight chain 2,3,4-saturated fatty aldehyde[c] '''=>''' 2 H+[c] '''+''' 1 NADH[c] '''+''' 1 an odd numbered straight chain 2,3,4-saturated fatty acid[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | == Pathways == | ||
| + | * [[PWY66-388]], fatty acid α-oxidation III: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-388 PWY66-388] | ||
| + | ** '''4''' reactions found over '''7''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=fatty aldehyde dehydrogenase}} | |
| − | + | {{#set: ec number=EC-1.2.1.3}} | |
| − | + | {{#set: in pathway=PWY66-388}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
| − | + | {{#set: reconstruction tool=pathwaytools}} | |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 21:20, 17 March 2018
Contents
Reaction RXN66-476
- direction:
- LEFT-TO-RIGHT
- common name:
- fatty aldehyde dehydrogenase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 NAD[c] + 1 WATER[c] + 1 Odd-Straight-Chain-234-Sat-FALD[c] => 2 PROTON[c] + 1 NADH[c] + 1 Odd-Straight-Chain-234-Sat-FA[c]
- With common name(s):
- 1 NAD+[c] + 1 H2O[c] + 1 an odd numbered straight chain 2,3,4-saturated fatty aldehyde[c] => 2 H+[c] + 1 NADH[c] + 1 an odd numbered straight chain 2,3,4-saturated fatty acid[c]
Genes associated with this reaction
Pathways
- PWY66-388, fatty acid α-oxidation III: PWY66-388
- 4 reactions found over 7 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
