Difference between revisions of "Ec-01 003910"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7105 CPD-7105] == * smiles: ** CC(=CCC1(=C(C(=C(C(=C1[O-])CC=C(C)C)O)C(CC(C)C)=O)O))C * inc...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-3221 PWY-3221] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3398 TAX-33...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-3221 PWY-3221] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3398 TAX-3398] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** dTDP-L-rhamnose biosynthesis II |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''1''' reactions found over '''3''' reactions in the full pathway | |
| − | * [[ | + | * [[DTDPGLUCDEHYDRAT-RXN]] |
| − | == Reaction(s) | + | ** 2 associated gene(s): |
| + | *** [[Ec-27_005770]] | ||
| + | *** [[Ec-01_007350]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | *** [[orthology-aragem]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=DTDPGLUCOSEPP-RXN DTDPGLUCOSEPP-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-5461 RXN-5461] | ||
== External links == | == External links == | ||
| − | * | + | * ARACYC: |
| − | ** [http:// | + | ** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-3221 PWY-3221] |
| − | + | {{#set: taxonomic range=TAX-3398}} | |
| − | {{#set: | + | {{#set: common name=dTDP-L-rhamnose biosynthesis II}} |
| − | {{#set: common name= | + | {{#set: reaction found=1}} |
| − | {{#set: | + | {{#set: total reaction=3}} |
| − | {{#set: | + | {{#set: completion rate=33.0}} |
| − | {{#set: | + | |
Revision as of 21:21, 17 March 2018
Pathway PWY-3221
- taxonomic range:
- common name:
- dTDP-L-rhamnose biosynthesis II
- Synonym(s):
Reaction(s) found
1 reactions found over 3 reactions in the full pathway
- DTDPGLUCDEHYDRAT-RXN
- 2 associated gene(s):
- 2 reconstruction source(s) associated:
Reaction(s) not found
External links
- ARACYC:
