Difference between revisions of "CPD-15677"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-03_003020 == * left end position: ** 3489035 * transcription direction: ** POSITIVE * right end position: ** 3493306 * centisome position: ** 53.4...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17347 CPD-17347] == * smiles: ** CCCCCC=CCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)C...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Ec-03_003020 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17347 CPD-17347] ==
* left end position:
+
* smiles:
** 3489035
+
** CCCCCC=CCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
* transcription direction:
+
* common name:
** POSITIVE
+
** (3R)-hydroxy-(11Z,14Z)-icosa-11,14-dienoyl-CoA
* right end position:
+
* inchi key:
** 3493306
+
** InChIKey=MNTSLNSVZACNCX-JPDDAYGWSA-J
* centisome position:
+
* molecular weight:
** 53.44182    
+
** 1069.99    
 
* Synonym(s):
 
* Synonym(s):
** Esi_0238_0007
+
** (3R)-hydroxy-20:2Δ11,14
** Esi0238_0007
+
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[ATPASE-RXN]]
+
* [[RXN-16096]]
** esiliculosus_genome
+
== Reaction(s) known to produce the compound ==
***go-term
+
* [[RXN-16095]]
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: left end position=3489035}}
+
* PUBCHEM:
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72193805 72193805]
{{#set: right end position=3493306}}
+
* CHEBI:
{{#set: centisome position=53.44182   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76408 76408]
{{#set: common name=Esi_0238_0007|Esi0238_0007}}
+
{{#set: smiles=CCCCCC=CCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
{{#set: reaction associated=ATPASE-RXN}}
+
{{#set: common name=(3R)-hydroxy-(11Z,14Z)-icosa-11,14-dienoyl-CoA}}
 +
{{#set: inchi key=InChIKey=MNTSLNSVZACNCX-JPDDAYGWSA-J}}
 +
{{#set: molecular weight=1069.99   }}
 +
{{#set: common name=(3R)-hydroxy-20:2Δ11,14}}
 +
{{#set: consumed by=RXN-16096}}
 +
{{#set: produced by=RXN-16095}}

Revision as of 21:22, 17 March 2018

Metabolite CPD-17347

  • smiles:
    • CCCCCC=CCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • common name:
    • (3R)-hydroxy-(11Z,14Z)-icosa-11,14-dienoyl-CoA
  • inchi key:
    • InChIKey=MNTSLNSVZACNCX-JPDDAYGWSA-J
  • molecular weight:
    • 1069.99
  • Synonym(s):
    • (3R)-hydroxy-20:2Δ11,14

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCC=CCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.