Difference between revisions of "RXN-1225"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-602 CPD-602] == * smiles: ** C(OP(=O)([O-])[O-])C2(OC(NC1(=C(N)C(=O)NC(=O)N1))C(O)C(O)2) *...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13677 RXN-13677] == * direction: ** LEFT-TO-RIGHT * common name: ** Peptidase M1, alanyl aminop...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-602 CPD-602] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13677 RXN-13677] ==
−
* smiles:
+
* direction:
−
** C(OP(=O)([O-])[O-])C2(OC(NC1(=C(N)C(=O)NC(=O)N1))C(O)C(O)2)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=LZEXYCAGPMYXLX-UMMCILCDSA-L
+
 
* common name:
 
* common name:
−
** 5-amino-6-(5-phospho-D-ribosylamino)uracil
+
** Peptidase M1, alanyl aminopeptidase, C-terminal
−
* molecular weight:
+
* ec number:
−
** 352.197   
+
** [http://enzyme.expasy.org/EC/3.4.11.2 EC-3.4.11.2]
 
* Synonym(s):
 
* Synonym(s):
−
** 5-amino-6-(ribosylamino)-2,4-(1H,3H)-pyrimidinedione 5'-phosphate
 
−
** 5-amino-6-(5'-phosphoribosylamino)uracil
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RIBOFLAVINSYNREDUC-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[WATER]][c] '''+''' 1 [[CPD-14705]][c] '''=>''' 1 [[CPD-14706]][c] '''+''' 1 [[GLY]][c]
−
* [[RIBOFLAVINSYNDEAM-RXN]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 H2O[c] '''+''' 1 4-hydroxy-2-nonenal-[Cys-Gly] conjugate[c] '''=>''' 1 4-hydroxy-2-nonenal-[L-Cys] conjugate[c] '''+''' 1 glycine[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Ec-09_003180]]
 +
** ESILICULOSUS_GENOME
 +
***EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-7112]], 4-hydroxy-2-nonenal detoxification: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7112 PWY-7112]
 +
** '''2''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245199 25245199]
+
{{#set: common name=Peptidase M1, alanyl aminopeptidase, C-terminal}}
−
* CHEBI:
+
{{#set: ec number=EC-3.4.11.2}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58453 58453]
+
{{#set: gene associated=Ec-09_003180}}
−
* BIGG : 37234
+
{{#set: in pathway=PWY-7112}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01268 C01268]
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: smiles=C(OP(=O)([O-])[O-])C2(OC(NC1(=C(N)C(=O)NC(=O)N1))C(O)C(O)2)}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: inchi key=InChIKey=LZEXYCAGPMYXLX-UMMCILCDSA-L}}
+
−
{{#set: common name=5-amino-6-(5-phospho-D-ribosylamino)uracil}}
+
−
{{#set: molecular weight=352.197    }}
+
−
{{#set: common name=5-amino-6-(ribosylamino)-2,4-(1H,3H)-pyrimidinedione 5'-phosphate|5-amino-6-(5'-phosphoribosylamino)uracil}}
+
−
{{#set: consumed by=RIBOFLAVINSYNREDUC-RXN}}
+
−
{{#set: produced by=RIBOFLAVINSYNDEAM-RXN}}
+

Revision as of 21:22, 17 March 2018

Reaction RXN-13677

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Peptidase M1, alanyl aminopeptidase, C-terminal
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 H2O[c] + 1 4-hydroxy-2-nonenal-[Cys-Gly] conjugate[c] => 1 4-hydroxy-2-nonenal-[L-Cys] conjugate[c] + 1 glycine[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7112, 4-hydroxy-2-nonenal detoxification: PWY-7112
    • 2 reactions found over 4 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-1225&oldid=12754"