Difference between revisions of "RXN-10034"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OLEATE-CPD OLEATE-CPD] == * smiles: ** CCCCCCCCC=CCCCCCCCC([O-])=O * inchi key: ** InChIKey=ZQP...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6854 PWY-6854] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6854 PWY-6854] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] |
| − | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
| − | * | + | |
* common name: | * common name: | ||
| − | ** | + | ** ethylene biosynthesis III (microbes) |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[RXN- | + | '''3''' reactions found over '''7''' reactions in the full pathway |
| − | * [[ | + | * [[RXN-12539]] |
| − | + | ** 0 associated gene: | |
| − | * [[ | + | ** 1 reconstruction source(s) associated: |
| − | * [[RXN- | + | *** [[annotation-esiliculosus_genome]] |
| − | * [[ | + | * [[RXN-12540]] |
| − | == Reaction(s) | + | ** 0 associated gene: |
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | * [[SUPEROX-DISMUT-RXN]] | ||
| + | ** 8 associated gene(s): | ||
| + | *** [[Ec-01_003850]] | ||
| + | *** [[Ec-04_002870]] | ||
| + | *** [[Ec-00_002760]] | ||
| + | *** [[Ec-01_007760]] | ||
| + | *** [[Ec-05_000630]] | ||
| + | *** [[Ec-08_003590]] | ||
| + | *** [[Ec-22_002450]] | ||
| + | *** [[Ec-25_000220]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=FERRIC-CHELATE-REDUCTASE-RXN FERRIC-CHELATE-REDUCTASE-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=R15-RXN R15-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12541 RXN-12541] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-14960 RXN-14960] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-4751}} | |
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | + | {{#set: common name=ethylene biosynthesis III (microbes)}} | |
| − | + | {{#set: reaction found=3}} | |
| − | + | {{#set: total reaction=7}} | |
| − | + | {{#set: completion rate=43.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Revision as of 21:22, 17 March 2018
Pathway PWY-6854
Reaction(s) found
3 reactions found over 7 reactions in the full pathway
- RXN-12539
- 0 associated gene:
- 1 reconstruction source(s) associated:
- RXN-12540
- 0 associated gene:
- 1 reconstruction source(s) associated:
- SUPEROX-DISMUT-RXN
- 8 associated gene(s):
- 1 reconstruction source(s) associated:
