Difference between revisions of "PWY-801"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CIS-ACONITATE CIS-ACONITATE] == * smiles: ** C([O-])(=O)C(=CC(=O)[O-])CC(=O)[O-] * inchi key: *...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1337 PWY0-1337] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1337 PWY0-1337] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** oleate β-oxidation |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''1''' reactions found over '''3''' reactions in the full pathway | |
− | == Reaction(s) | + | * [[RXN0-5393]] |
− | * [ | + | ** 4 associated gene(s): |
− | * [ | + | *** [[Ec-16_003560]] |
+ | *** [[Ec-06_001380]] | ||
+ | *** [[Ec-14_006530]] | ||
+ | *** [[Ec-16_001250]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5390 RXN0-5390] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5391 RXN0-5391] | ||
== External links == | == External links == | ||
− | * | + | * ECOCYC: |
− | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY0-1337 PWY0-1337] | |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | ** [http:// | + | {{#set: common name=oleate β-oxidation}} |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=3}} | |
− | + | {{#set: completion rate=33.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 21:25, 17 March 2018
Pathway PWY0-1337
- taxonomic range:
- common name:
- oleate β-oxidation
- Synonym(s):
Reaction(s) found
1 reactions found over 3 reactions in the full pathway
- RXN0-5393
- 4 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC: