Difference between revisions of "Ec-15 000670"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-37 CPD-37] == * smiles: ** [CH](=O)C(O)C(O)CC(=O)C(=O)[O-] * inchi key: ** InChIKey=IMUGYKF...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16629 RXN-16629] == * direction: ** LEFT-TO-RIGHT * common name: ** Beta-ketoacyl synthase, N-t...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-37 CPD-37] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16629 RXN-16629] ==
−
* smiles:
+
* direction:
−
** [CH](=O)C(O)C(O)CC(=O)C(=O)[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=IMUGYKFHMJLTOU-UCORVYFPSA-M
+
 
* common name:
 
* common name:
−
** 5-dehydro-4-deoxy-D-glucuronate
+
** Beta-ketoacyl synthase, N-terminal
−
* molecular weight:
+
** beta-ketoacyl synthase, partial
−
** 175.118   
+
** Thiolase-like, subgroup
 +
** 3-oxoacyl-[acyl-carrier-protein] synthase
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/2.3.1.41 EC-2.3.1.41]
 
* Synonym(s):
 
* Synonym(s):
−
** 4-deoxy-L-threo-5-hexosulose uronate
 
−
** 4,5-dihydroxy-2,6-dioxo-hexanoate
 
−
** (4S,5R)-4,5-dihydroxy-2,6-dioxohexanoate
 
−
** 5-keto-4-deoxyuronate
 
−
** DKI
 
−
** 4-deoxy-5-ketouronic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1 [[MALONYL-ACP]][c] '''+''' 1 [[Oleoyl-ACPs]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[ACP]][c] '''+''' 1 [[11Z-3-oxo-icos-11-enoyl-ACPs]][c]
−
* [[RXN-16475]]
+
* With common name(s):
 +
** 1 a malonyl-[acp][c] '''+''' 1 an oleoyl-[acp][c] '''+''' 1 H+[c] '''=>''' 1 CO2[c] '''+''' 1 a holo-[acyl-carrier protein][c] '''+''' 1 an (11Z)-3-oxo-icos-11-enoyl-[acp][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Ec-27_003480]]
 +
** ESILICULOSUS_GENOME
 +
***EC-NUMBER
 +
* [[Ec-12_000640]]
 +
** ESILICULOSUS_GENOME
 +
***EC-NUMBER
 +
* [[Ec-27_002090]]
 +
** ESILICULOSUS_GENOME
 +
***EC-NUMBER
 +
* [[Ec-12_000650]]
 +
** ESILICULOSUS_GENOME
 +
***GO-TERM
 +
== Pathways  ==
 +
* [[PWY-7663]], gondoate biosynthesis (anaerobic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7663 PWY-7663]
 +
** '''3''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9548606 9548606]
+
{{#set: common name=Beta-ketoacyl synthase, N-terminal}}
−
* CHEMSPIDER:
+
{{#set: common name=beta-ketoacyl synthase, partial}}
−
** [http://www.chemspider.com/Chemical-Structure.7827529.html 7827529]
+
{{#set: common name=Thiolase-like, subgroup}}
−
* CHEBI:
+
{{#set: common name=3-oxoacyl-[acyl-carrier-protein] synthase}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17117 17117]
+
{{#set: ec number=EC-2.3.1.41}}
−
* LIGAND-CPD:
+
{{#set: gene associated=Ec-27_003480|Ec-12_000640|Ec-27_002090|Ec-12_000650}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04053 C04053]
+
{{#set: in pathway=PWY-7663}}
−
{{#set: smiles=[CH](=O)C(O)C(O)CC(=O)C(=O)[O-]}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: inchi key=InChIKey=IMUGYKFHMJLTOU-UCORVYFPSA-M}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: common name=5-dehydro-4-deoxy-D-glucuronate}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: molecular weight=175.118    }}
+
−
{{#set: common name=4-deoxy-L-threo-5-hexosulose uronate|4,5-dihydroxy-2,6-dioxo-hexanoate|(4S,5R)-4,5-dihydroxy-2,6-dioxohexanoate|5-keto-4-deoxyuronate|DKI|4-deoxy-5-ketouronic acid}}
+
−
{{#set: consumed or produced by=RXN-16475}}
+

Revision as of 21:28, 17 March 2018

Reaction RXN-16629

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Beta-ketoacyl synthase, N-terminal
    • beta-ketoacyl synthase, partial
    • Thiolase-like, subgroup
    • 3-oxoacyl-[acyl-carrier-protein] synthase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7663, gondoate biosynthesis (anaerobic): PWY-7663
    • 3 reactions found over 4 reactions in the full pathway

Reconstruction information

External links

"3-oxoacyl-[acyl-carrier-protein] synthase" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-15_000670&oldid=13141"