Difference between revisions of "ARGSUCCINSYN-RXN"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-27_003470 == * left end position: ** 2999236 * transcription direction: ** POSITIVE * right end position: ** 3005321 * centisome position: ** 46.5...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TREHALOSE-6P TREHALOSE-6P] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)COP([O-])(=O)[O-]...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TREHALOSE-6P TREHALOSE-6P] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)COP([O-])(=O)[O-])O)O)O)))O |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=LABSPYBHMPDTEL-LIZSDCNHSA-L |
| − | * | + | * common name: |
| − | ** | + | ** α,α-trehalose 6-phosphate |
| − | * | + | * molecular weight: |
| − | ** | + | ** 420.263 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** α,α-D-trehalose 6-phosphate |
| − | + | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[TREHALOSEPHOSPHA-RXN]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[TREHALOSE6PSYN-RXN]] | |
| − | == | + | * [[2.4.1.36-RXN]] |
| − | * [[ | + | == Reaction(s) of unknown directionality == |
| − | * [[ | + | * [[RXN-761]] |
| − | + | ||
| − | * [[ | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 4484-88-2 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246105 25246105] |
| − | {{#set: | + | * HMDB : HMDB01124 |
| − | {{#set: common name= | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00689 C00689] |
| − | {{#set: | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58429 58429] | ||
| + | * BIGG : 35708 | ||
| + | {{#set: smiles=C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)COP([O-])(=O)[O-])O)O)O)))O}} | ||
| + | {{#set: inchi key=InChIKey=LABSPYBHMPDTEL-LIZSDCNHSA-L}} | ||
| + | {{#set: common name=α,α-trehalose 6-phosphate}} | ||
| + | {{#set: molecular weight=420.263 }} | ||
| + | {{#set: common name=α,α-D-trehalose 6-phosphate}} | ||
| + | {{#set: consumed by=TREHALOSEPHOSPHA-RXN}} | ||
| + | {{#set: produced by=TREHALOSE6PSYN-RXN|2.4.1.36-RXN}} | ||
| + | {{#set: reversible reaction associated=RXN-761}} | ||
Revision as of 21:28, 17 March 2018
Contents
Metabolite TREHALOSE-6P
- smiles:
- C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)COP([O-])(=O)[O-])O)O)O)))O
- inchi key:
- InChIKey=LABSPYBHMPDTEL-LIZSDCNHSA-L
- common name:
- α,α-trehalose 6-phosphate
- molecular weight:
- 420.263
- Synonym(s):
- α,α-D-trehalose 6-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)COP([O-])(=O)[O-])O)O)O)))O" cannot be used as a page name in this wiki.
