Difference between revisions of "Ec-27 003300"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16117 RXN-16117] == * direction: ** LEFT-TO-RIGHT * common name: ** Glycerol-3-phosphate O-acyl...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-236 CPD-236] == * smiles: ** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16117 RXN-16117] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-236 CPD-236] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))C([O-])=O)))
 +
* inchi key:
 +
** InChIKey=BKBYHSYZKIAJDA-LPEMZMRWSA-M
 
* common name:
 
* common name:
−
** Glycerol-3-phosphate O-acyltransferase
+
** gibberellin A29
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/2.3.1.15 EC-2.3.1.15]
+
** 347.387   
 
* Synonym(s):
 
* Synonym(s):
 +
** GA29
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[GLYCEROL-3P]][c] '''+''' 1 [[CPD-17370]][c] '''=>''' 1 [[CPD-17372]][c] '''+''' 1 [[CO-A]][c]
+
* [[RXN-113]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 sn-glycerol 3-phosphate[c] '''+''' 1 18-hydroxyoleoyl-CoA[c] '''=>''' 1 1-[18-hydroxyoleyl]-2-lyso-phosphatidate[c] '''+''' 1 coenzyme A[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-01_003960]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-6453]], stigma estolide biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6453 PWY-6453]
+
−
** '''2''' reactions found over '''7''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=Glycerol-3-phosphate O-acyltransferase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200412 25200412]
−
{{#set: ec number=EC-2.3.1.15}}
+
* CHEBI:
−
{{#set: gene associated=Ec-01_003960}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28040 28040]
−
{{#set: in pathway=PWY-6453}}
+
* LIGAND-CPD:
−
{{#set: reconstruction category=annotation}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C06096 C06096]
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: smiles=C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))C([O-])=O)))}}
−
{{#set: reconstruction source=esiliculosus_genome}}
+
{{#set: inchi key=InChIKey=BKBYHSYZKIAJDA-LPEMZMRWSA-M}}
 +
{{#set: common name=gibberellin A29}}
 +
{{#set: molecular weight=347.387    }}
 +
{{#set: common name=GA29}}
 +
{{#set: produced by=RXN-113}}

Revision as of 21:29, 17 March 2018

Metabolite CPD-236

  • smiles:
    • C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))C([O-])=O)))
  • inchi key:
    • InChIKey=BKBYHSYZKIAJDA-LPEMZMRWSA-M
  • common name:
    • gibberellin A29
  • molecular weight:
    • 347.387
  • Synonym(s):
    • GA29

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))C([O-])=O)))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-27_003300&oldid=13198"