Difference between revisions of "1.1.1.178-RXN"

Revision as of 21:29, 17 March 2018

@@ Line 1: / Line 1: @@
 [[Category:Metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROTOHEME PROTOHEME] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Prime-Ribonucleoside-Monophosphates 3-Prime-Ribonucleoside-Monophosphates] ==
-* smiles:
-** C=CC1(C(C)=C7(C=C8(C(C)=C(CCC(=O)[O-])C6(=[N+]([Fe--]24(N(C=1C=C3(C(C)=C(C=C)C(=[N+]23)C=C5(C(C)=C(CCC(=O)[O-])C(N45)=C6)))7))8))))
-* inchi key:
-** InChIKey=KABFMIBPWCXCRK-RGGAHWMASA-J
 * common name:
-** ferroheme b
+** a ribonucleoside 3'-phosphate
-* molecular weight:
-** 614.482
 * Synonym(s):
-** protoheme IX
-** ferroprotoporphyrin IX
 == Reaction(s) known to consume the compound ==
 == Reaction(s) known to produce the compound ==
+* [[3.1.27.1-RXN]]
+* [[3.1.27.5-RXN]]
 == Reaction(s) of unknown directionality ==
-* [[PROTOHEMEFERROCHELAT-RXN]]
 == External links  ==
-* CHEBI:
+{{#set: common name=a ribonucleoside 3'-phosphate}}
-** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17627 17627]
+{{#set: produced by=3.1.27.1-RXN|3.1.27.5-RXN}}
-{{#set: smiles=C=CC1(C(C)=C7(C=C8(C(C)=C(CCC(=O)[O-])C6(=[N+]([Fe--]24(N(C=1C=C3(C(C)=C(C=C)C(=[N+]23)C=C5(C(C)=C(CCC(=O)[O-])C(N45)=C6)))7))8))))}}
-{{#set: inchi key=InChIKey=KABFMIBPWCXCRK-RGGAHWMASA-J}}
-{{#set: common name=ferroheme b}}
-{{#set: molecular weight=614.482    }}
-{{#set: common name=protoheme IX|ferroprotoporphyrin IX}}
-{{#set: consumed or produced by=PROTOHEMEFERROCHELAT-RXN}}