Difference between revisions of "Unwound-DNA"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-06_008730 == * left end position: ** 6387366 * transcription direction: ** NEGATIVE * right end position: ** 6408900 * centisome position: ** 72.9...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4618 CPD-4618] == * smiles: ** CC(=CCNC1(C2(=C(N=CN=1)N=CN2C3(C(C(C(C(O3)CO)O)O)O))))CO * i...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4618 CPD-4618] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(=CCNC1(C2(=C(N=CN=1)N=CN2C3(C(C(C(C(O3)CO)O)O)O))))CO |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=HTDHRCLVWUEXIS-GIHYWFGSSA-N |
| − | * | + | * common name: |
| − | ** | + | ** cis-zeatin-7-N-glucoside |
| − | * | + | * molecular weight: |
| − | ** | + | ** 381.388 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-4733]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244153 25244153] | |
| − | {{#set: | + | * HMDB : HMDB12201 |
| − | {{#set: | + | {{#set: smiles=CC(=CCNC1(C2(=C(N=CN=1)N=CN2C3(C(C(C(C(O3)CO)O)O)O))))CO}} |
| − | {{#set: common name= | + | {{#set: inchi key=InChIKey=HTDHRCLVWUEXIS-GIHYWFGSSA-N}} |
| − | {{#set: | + | {{#set: common name=cis-zeatin-7-N-glucoside}} |
| − | {{#set: | + | {{#set: molecular weight=381.388 }} |
| + | {{#set: produced by=RXN-4733}} | ||
Revision as of 20:28, 17 March 2018
Contents
Metabolite CPD-4618
- smiles:
- CC(=CCNC1(C2(=C(N=CN=1)N=CN2C3(C(C(C(C(O3)CO)O)O)O))))CO
- inchi key:
- InChIKey=HTDHRCLVWUEXIS-GIHYWFGSSA-N
- common name:
- cis-zeatin-7-N-glucoside
- molecular weight:
- 381.388
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- HMDB : HMDB12201
