Difference between revisions of "RXN-10715"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-146 RXN66-146] == * direction: ** LEFT-TO-RIGHT * common name: ** Aromatic-ring hydroxylase-l...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2743 CPD-2743] == * smiles: ** C1(CC[CH](N(=O)(C)1)C2(=CN=CC=C2)) * inchi key: ** InChIKey=...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-146 RXN66-146] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2743 CPD-2743] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C1(CC[CH](N(=O)(C)1)C2(=CN=CC=C2))
 +
* inchi key:
 +
** InChIKey=RWFBQHICRCUQJJ-NUHJPDEHSA-N
 
* common name:
 
* common name:
−
** Aromatic-ring hydroxylase-like
+
** nicotine-1'-N-oxide
−
** Monooxygenase, FAD-binding
+
* molecular weight:
−
* ec number:
+
** 178.233   
−
** [http://enzyme.expasy.org/EC/1.14.14.1 EC-1.14.14.1]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** nicotine N'-oxide
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[Red-NADPH-Hemoprotein-Reductases]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[NICOTINE]][c] '''=>''' 1 [[Ox-NADPH-Hemoprotein-Reductases]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[CPD-3187]][c]
+
* [[RXN66-81]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 a reduced [NADPH-hemoprotein reductase][c] '''+''' 1 oxygen[c] '''+''' 1 (S)-nicotine[c] '''=>''' 1 an oxidized [NADPH-hemoprotein reductase][c] '''+''' 1 H2O[c] '''+''' 1 2'-hydroxynicotine[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-01_010880]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
* [[Ec-26_003280]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
* [[Ec-00_001320]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY66-201]], nicotine degradation IV: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-201 PWY66-201]
+
−
** '''2''' reactions found over '''17''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=Aromatic-ring hydroxylase-like}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=68107 68107]
−
{{#set: common name=Monooxygenase, FAD-binding}}
+
* CHEMSPIDER:
−
{{#set: ec number=EC-1.14.14.1}}
+
** [http://www.chemspider.com/Chemical-Structure.61415.html 61415]
−
{{#set: gene associated=Ec-01_010880|Ec-26_003280|Ec-00_001320}}
+
* HMDB : HMDB01497
−
{{#set: in pathway=PWY66-201}}
+
{{#set: smiles=C1(CC[CH](N(=O)(C)1)C2(=CN=CC=C2))}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: inchi key=InChIKey=RWFBQHICRCUQJJ-NUHJPDEHSA-N}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: common name=nicotine-1'-N-oxide}}
−
{{#set: reconstruction source=esiliculosus_genome}}
+
{{#set: molecular weight=178.233    }}
 +
{{#set: common name=nicotine N'-oxide}}
 +
{{#set: produced by=RXN66-81}}

Revision as of 22:30, 17 March 2018

Metabolite CPD-2743

  • smiles:
    • C1(CC[CH](N(=O)(C)1)C2(=CN=CC=C2))
  • inchi key:
    • InChIKey=RWFBQHICRCUQJJ-NUHJPDEHSA-N
  • common name:
    • nicotine-1'-N-oxide
  • molecular weight:
    • 178.233
  • Synonym(s):
    • nicotine N'-oxide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • PUBCHEM:
  • CHEMSPIDER:
  • HMDB : HMDB01497
"C1(CC[CH](N(=O)(C)1)C2(=CN=CC=C2))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-10715&oldid=13284"