Difference between revisions of "Odd-Straight-Chain-234-Sat-FALD"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-11_006230 == * left end position: ** 6182280 * transcription direction: ** NEGATIVE * right end position: ** 6187237 * centisome position: ** 98.2...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13172 CPD-13172] == * smiles: ** C(=O)(C1(O)(C=CCCC(=O)1))[O-] * inchi key: ** InChIKey=WEZ...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-11_006230 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13172 CPD-13172] ==
−
* left end position:
+
* smiles:
−
** 6182280
+
** C(=O)(C1(O)(C=CCCC(=O)1))[O-]
−
* transcription direction:
+
* inchi key:
−
** NEGATIVE
+
** InChIKey=WEZWWZKUBQCMBL-UHFFFAOYSA-M
−
* right end position:
+
* common name:
−
** 6187237
+
** 6-hydroxy-2-cyclohexen-one-carboxylate
−
* centisome position:
+
* molecular weight:
−
** 98.292786    
+
** 155.13    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0031_0150
+
** 6-hydroxy-2-cyclohexen-one-carboxylic acid
−
** Esi0031_0150
+
** HCC
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[PANTOTHENATE-KIN-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** esiliculosus_genome
+
* [[RXN-12252]]
−
***go-term
+
== Reaction(s) of unknown directionality ==
−
== Pathways associated ==
+
−
* [[PANTO-PWY]]
+
−
* [[PWY-3961]]
+
−
* [[COA-PWY-1]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=6182280}}
+
* PUBCHEM:
−
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940166 52940166]
−
{{#set: right end position=6187237}}
+
{{#set: smiles=C(=O)(C1(O)(C=CCCC(=O)1))[O-]}}
−
{{#set: centisome position=98.292786   }}
+
{{#set: inchi key=InChIKey=WEZWWZKUBQCMBL-UHFFFAOYSA-M}}
−
{{#set: common name=Esi_0031_0150|Esi0031_0150}}
+
{{#set: common name=6-hydroxy-2-cyclohexen-one-carboxylate}}
−
{{#set: reaction associated=PANTOTHENATE-KIN-RXN}}
+
{{#set: molecular weight=155.13   }}
−
{{#set: pathway associated=PANTO-PWY|PWY-3961|COA-PWY-1}}
+
{{#set: common name=6-hydroxy-2-cyclohexen-one-carboxylic acid|HCC}}
 +
{{#set: produced by=RXN-12252}}

Revision as of 21:30, 17 March 2018

Metabolite CPD-13172

  • smiles:
    • C(=O)(C1(O)(C=CCCC(=O)1))[O-]
  • inchi key:
    • InChIKey=WEZWWZKUBQCMBL-UHFFFAOYSA-M
  • common name:
    • 6-hydroxy-2-cyclohexen-one-carboxylate
  • molecular weight:
    • 155.13
  • Synonym(s):
    • 6-hydroxy-2-cyclohexen-one-carboxylic acid
    • HCC

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(=O)(C1(O)(C=CCCC(=O)1))[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Odd-Straight-Chain-234-Sat-FALD&oldid=13297"