Difference between revisions of "Ec-14 004250"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-02_000470 == * left end position: ** 448045 * transcription direction: ** NEGATIVE * right end position: ** 455672 * centisome position: ** 6.8636...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MG-PROTOPORPHYRIN-MONOMETHYL-ESTER MG-PROTOPORPHYRIN-MONOMETHYL-ESTER] == * smiles: ** C=CC2(C(...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-02_000470 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MG-PROTOPORPHYRIN-MONOMETHYL-ESTER MG-PROTOPORPHYRIN-MONOMETHYL-ESTER] ==
−
* left end position:
+
* smiles:
−
** 448045
+
** C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(CCC(=O)OC)C(N56)=C7))))8))))
−
* transcription direction:
+
* common name:
−
** NEGATIVE
+
** magnesium-protoporphyrin IX 13-monomethyl ester
−
* right end position:
+
* molecular weight:
−
** 455672
+
** 597.975    
−
* centisome position:
+
−
** 6.8636546    
+
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0083_0078
+
** Mg-protoporphyrin monomethyl ester
−
** Esi0083_0078
+
** magnesium protoporphyrin monomethyl ester
−
** CAT
+
** MgPMME
 +
** magnesium-protoporphyrin IX 13-methyl ester
 +
** MgP monomethyl ester
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[CATAL-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** esiliculosus_genome
+
* [[RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN]]
−
***ec-number
+
== Reaction(s) of unknown directionality ==
−
* [[PEROXID-RXN]]
+
−
** esiliculosus_genome
+
−
***go-term
+
−
* [[RXN-14189]]
+
−
** esiliculosus_genome
+
−
***ec-number
+
−
* [[RXN-14240]]
+
−
** esiliculosus_genome
+
−
***go-term
+
−
* [[RXN-15288]]
+
−
** esiliculosus_genome
+
−
***go-term
+
−
* [[RXN-17352]]
+
−
** esiliculosus_genome
+
−
***go-term
+
−
* [[RXN-8635]]
+
−
** esiliculosus_genome
+
−
***go-term
+
−
* [[RXN-8667]]
+
−
** esiliculosus_genome
+
−
***automated-name-match
+
−
* [[RXN66-1]]
+
−
** esiliculosus_genome
+
−
***ec-number
+
−
== Pathways associated ==
+
−
* [[PWY-7214]]
+
−
* [[PWY-7445]]
+
−
* [[PWY66-162]]
+
−
* [[DETOX1-PWY-1]]
+
−
* [[PWY-6824]]
+
−
* [[DETOX1-PWY]]
+
−
* [[PWY-5469]]
+
−
* [[PWY-5506]]
+
−
* [[PWY-5466]]
+
−
* [[PWY-5461]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=448045}}
+
* PUBCHEM:
−
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657954 90657954]
−
{{#set: right end position=455672}}
+
* CHEBI:
−
{{#set: centisome position=6.8636546   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60491 60491]
−
{{#set: common name=Esi_0083_0078|Esi0083_0078|CAT}}
+
* LIGAND-CPD:
−
{{#set: reaction associated=CATAL-RXN|PEROXID-RXN|RXN-14189|RXN-14240|RXN-15288|RXN-17352|RXN-8635|RXN-8667|RXN66-1}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C04536 C04536]
−
{{#set: pathway associated=PWY-7214|PWY-7445|PWY66-162|DETOX1-PWY-1|PWY-6824|DETOX1-PWY|PWY-5469|PWY-5506|PWY-5466|PWY-5461}}
+
{{#set: smiles=C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(CCC(=O)OC)C(N56)=C7))))8))))}}
 +
{{#set: common name=magnesium-protoporphyrin IX 13-monomethyl ester}}
 +
{{#set: molecular weight=597.975   }}
 +
{{#set: common name=Mg-protoporphyrin monomethyl ester|magnesium protoporphyrin monomethyl ester|MgPMME|magnesium-protoporphyrin IX 13-methyl ester|MgP monomethyl ester}}
 +
{{#set: produced by=RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN}}

Revision as of 21:30, 17 March 2018

Metabolite MG-PROTOPORPHYRIN-MONOMETHYL-ESTER

  • smiles:
    • C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(CCC(=O)OC)C(N56)=C7))))8))))
  • common name:
    • magnesium-protoporphyrin IX 13-monomethyl ester
  • molecular weight:
    • 597.975
  • Synonym(s):
    • Mg-protoporphyrin monomethyl ester
    • magnesium protoporphyrin monomethyl ester
    • MgPMME
    • magnesium-protoporphyrin IX 13-methyl ester
    • MgP monomethyl ester

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(CCC(=O)OC)C(N56)=C7))))8))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-14_004250&oldid=13300"