Difference between revisions of "RXN-13426"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2231 CPD0-2231] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)...")
 
(Created page with "Category:Gene == Gene Ec-20_001030 == * left end position: ** 1005929 * transcription direction: ** POSITIVE * right end position: ** 1007964 * centisome position: ** 19.5...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2231 CPD0-2231] ==
+
== Gene Ec-20_001030 ==
−
* smiles:
+
* left end position:
−
** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23)))
+
** 1005929
−
* inchi key:
+
* transcription direction:
−
** InChIKey=BKUSIKGSPSFQAC-RRKCRQDMSA-K
+
** POSITIVE
−
* common name:
+
* right end position:
−
** dIDP
+
** 1007964
−
* molecular weight:
+
* centisome position:
−
** 409.165    
+
** 19.508278    
 
* Synonym(s):
 
* Synonym(s):
−
** deoxyinosine diphosphate
+
** Esi_0195_0044
 +
** Esi0195_0044
 +
** NDA
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[NADH-DEHYDROG-A-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** esiliculosus_genome
−
* [[RXN-14228]]
+
***ec-number
 +
== Pathways associated ==
 +
* [[PWY-4302]]
 +
* [[PWY-3781]]
 +
* [[PWY-5083]]
 +
* [[PWY0-1334]]
 +
* [[PWY0-1335]]
 +
* [[PWY-6692]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: left end position=1005929}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01344 C01344]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=1007964}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62286 62286]
+
{{#set: centisome position=19.508278   }}
−
* BIGG : 37395
+
{{#set: common name=Esi_0195_0044|Esi0195_0044|NDA}}
−
* PUBCHEM:
+
{{#set: reaction associated=NADH-DEHYDROG-A-RXN}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173552 46173552]
+
{{#set: pathway associated=PWY-4302|PWY-3781|PWY-5083|PWY0-1334|PWY0-1335|PWY-6692}}
−
* HMDB : HMDB03536
+
−
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23)))}}
+
−
{{#set: inchi key=InChIKey=BKUSIKGSPSFQAC-RRKCRQDMSA-K}}
+
−
{{#set: common name=dIDP}}
+
−
{{#set: molecular weight=409.165   }}
+
−
{{#set: common name=deoxyinosine diphosphate}}
+
−
{{#set: consumed or produced by=RXN-14228}}
+

Revision as of 21:32, 17 March 2018

Gene Ec-20_001030

  • left end position:
    • 1005929
  • transcription direction:
    • POSITIVE
  • right end position:
    • 1007964
  • centisome position:
    • 19.508278
  • Synonym(s):
    • Esi_0195_0044
    • Esi0195_0044
    • NDA

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-13426&oldid=13420"