Difference between revisions of "GDP-4-DEHYDRO-6-DEOXY-D-MANNOSE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9515 RXN-9515] == * direction: ** LEFT-TO-RIGHT * common name: ** crotonyl-[acyl-carrier protei...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12897 CPD-12897] == * smiles: ** CC(C)=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9515 RXN-9515] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12897 CPD-12897] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 +
* inchi key:
 +
** InChIKey=LPMIXVANMSEERY-FUEUKBNZSA-J
 
* common name:
 
* common name:
−
** crotonyl-[acyl-carrier protein] reductase (NADP)
+
** 7-methyl-3-oxooct-6-enoyl-CoA
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/1.3.1.10 EC-1.3.1.10]
+
** 915.695   
−
** [http://enzyme.expasy.org/EC/1.3.1.39 EC-1.3.1.39]
+
−
** [http://enzyme.expasy.org/EC/2.3.1.85 EC-2.3.1.85]
+
−
** [http://enzyme.expasy.org/EC/2.3.1.86 EC-2.3.1.86]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** 7-methyl-3-oxo-6-octenoyl-CoA
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-11917]]
−
** 1 [[NADPH]][c] '''+''' 1 [[Crotonyl-ACPs]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[Butanoyl-ACPs]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 NADPH[c] '''+''' 1 a crotonyl-[acp][c] '''+''' 1 H+[c] '''=>''' 1 NADP+[c] '''+''' 1 a butyryl-[acp][c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
* [[PWY-5994]], palmitate biosynthesis I (animals and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5994 PWY-5994]
+
−
** '''20''' reactions found over '''31''' reactions in the full pathway
+
−
* [[PWY-7388]], octanoyl-[acyl-carrier protein] biosynthesis (mitochondria, yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7388 PWY-7388]
+
−
** '''9''' reactions found over '''9''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=crotonyl-[acyl-carrier protein] reductase (NADP)}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986200 50986200]
−
{{#set: ec number=EC-1.3.1.10}}
+
* CHEBI:
−
{{#set: ec number=EC-1.3.1.39}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71410 71410]
−
{{#set: ec number=EC-2.3.1.85}}
+
* LIGAND-CPD:
−
{{#set: ec number=EC-2.3.1.86}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C16466 C16466]
−
{{#set: in pathway=PWY-5994|PWY-7388}}
+
* HMDB : HMDB60421
−
{{#set: reconstruction category=annotation}}
+
{{#set: smiles=CC(C)=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: inchi key=InChIKey=LPMIXVANMSEERY-FUEUKBNZSA-J}}
−
{{#set: reconstruction source=esiliculosus_genome}}
+
{{#set: common name=7-methyl-3-oxooct-6-enoyl-CoA}}
 +
{{#set: molecular weight=915.695    }}
 +
{{#set: common name=7-methyl-3-oxo-6-octenoyl-CoA}}
 +
{{#set: consumed by=RXN-11917}}

Revision as of 21:33, 17 March 2018

Metabolite CPD-12897

  • smiles:
    • CC(C)=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • inchi key:
    • InChIKey=LPMIXVANMSEERY-FUEUKBNZSA-J
  • common name:
    • 7-methyl-3-oxooct-6-enoyl-CoA
  • molecular weight:
    • 915.695
  • Synonym(s):
    • 7-methyl-3-oxo-6-octenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=GDP-4-DEHYDRO-6-DEOXY-D-MANNOSE&oldid=13503"