Difference between revisions of "RXN-10994"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=EDTA EDTA] == * smiles: ** C(C[N+](CC([O-])=O)CC([O-])=O)[N+](CC([O-])=O)CC([O-])=O * inchi key...") |
(Created page with "Category:Gene == Gene Ec-08_005450 == * left end position: ** 5199953 * transcription direction: ** NEGATIVE * right end position: ** 5213503 * centisome position: ** 77.6...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-08_005450 == |
− | * | + | * left end position: |
− | ** | + | ** 5199953 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 5213503 |
− | * | + | * centisome position: |
− | ** | + | ** 77.64524 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0005_0270 |
− | ** | + | ** Esi0005_0270 |
+ | ** NDA | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[NADH-DEHYDROG-A-RXN]] |
− | == | + | ** esiliculosus_genome |
− | * [[ | + | ***ec-number |
− | + | == Pathways associated == | |
− | * [[ | + | * [[PWY-4302]] |
+ | * [[PWY-3781]] | ||
+ | * [[PWY-5083]] | ||
+ | * [[PWY0-1334]] | ||
+ | * [[PWY0-1335]] | ||
+ | * [[PWY-6692]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=5199953}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=5213503}} | |
− | + | {{#set: centisome position=77.64524 }} | |
− | + | {{#set: common name=Esi_0005_0270|Esi0005_0270|NDA}} | |
− | + | {{#set: reaction associated=NADH-DEHYDROG-A-RXN}} | |
− | + | {{#set: pathway associated=PWY-4302|PWY-3781|PWY-5083|PWY0-1334|PWY0-1335|PWY-6692}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 21:34, 17 March 2018
Gene Ec-08_005450
- left end position:
- 5199953
- transcription direction:
- NEGATIVE
- right end position:
- 5213503
- centisome position:
- 77.64524
- Synonym(s):
- Esi_0005_0270
- Esi0005_0270
- NDA
Reactions associated
- NADH-DEHYDROG-A-RXN
- esiliculosus_genome
- ec-number
- esiliculosus_genome