Difference between revisions of "3-oxo-cis-D7-tetradecenoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7066 CPD-7066] == * smiles: ** CC(C(=O)[O-])C(O)C([O-])=O * inchi key: ** InChIKey=NPYQJIHH...")
 
(Created page with "Category:Gene == Gene Ec-11_005510 == * left end position: ** 5511573 * transcription direction: ** POSITIVE * right end position: ** 5516739 * centisome position: ** 87.6...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7066 CPD-7066] ==
+
== Gene Ec-11_005510 ==
−
* smiles:
+
* left end position:
−
** CC(C(=O)[O-])C(O)C([O-])=O
+
** 5511573
−
* inchi key:
+
* transcription direction:
−
** InChIKey=NPYQJIHHTGFBLN-STHAYSLISA-L
+
** POSITIVE
−
* common name:
+
* right end position:
−
** (2R,3S)-3-methylmalate
+
** 5516739
−
* molecular weight:
+
* centisome position:
−
** 146.099    
+
** 87.62914    
 
* Synonym(s):
 
* Synonym(s):
−
** D-erythro-3-methylmalate
+
** Esi_0031_0033
−
** erythro-β-methyl-D-malate
+
** Esi0031_0033
−
** β-erythro-methylmalate
+
−
** β-methyl-D-malate
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-7745]]
+
* [[GDPMANDEHYDRA-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** esiliculosus_genome
−
== Reaction(s) of unknown directionality ==
+
***go-term
 +
** [[pantograph]]-[[aragem]]
 +
== Pathways associated ==
 +
* [[GDPRHAMSYN-PWY]]
 +
* [[PWY-66]]
 +
* [[PWY-5740]]
 +
* [[PWY-7573]]
 +
* [[PWY-5738]]
 +
* [[PWY-5739]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=5511573}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266666 45266666]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=5516739}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58511 58511]
+
{{#set: centisome position=87.62914    }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0031_0033|Esi0031_0033}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06029 C06029]
+
{{#set: reaction associated=GDPMANDEHYDRA-RXN}}
−
{{#set: smiles=CC(C(=O)[O-])C(O)C([O-])=O}}
+
{{#set: pathway associated=GDPRHAMSYN-PWY|PWY-66|PWY-5740|PWY-7573|PWY-5738|PWY-5739}}
−
{{#set: inchi key=InChIKey=NPYQJIHHTGFBLN-STHAYSLISA-L}}
+
−
{{#set: common name=(2R,3S)-3-methylmalate}}
+
−
{{#set: molecular weight=146.099    }}
+
−
{{#set: common name=D-erythro-3-methylmalate|erythro-β-methyl-D-malate|β-erythro-methylmalate|β-methyl-D-malate}}
+
−
{{#set: consumed by=RXN-7745}}
+

Revision as of 21:34, 17 March 2018

Gene Ec-11_005510

  • left end position:
    • 5511573
  • transcription direction:
    • POSITIVE
  • right end position:
    • 5516739
  • centisome position:
    • 87.62914
  • Synonym(s):
    • Esi_0031_0033
    • Esi0031_0033

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=3-oxo-cis-D7-tetradecenoyl-ACPs&oldid=13589"