Difference between revisions of "2E-5Z-tetradeca-2-5-dienoyl-ACPs"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12014 CPD-12014] == * smiles: ** CC(=O)NCCC1(=CNC2(C1=CC(OC)=C(O)C=2)) * inchi key: ** InCh...") |
(Created page with "Category:Gene == Gene Ec-21_003700 == * left end position: ** 4682340 * transcription direction: ** POSITIVE * right end position: ** 4684239 * centisome position: ** 63.4...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-21_003700 == |
− | * | + | * left end position: |
− | ** | + | ** 4682340 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 4684239 |
− | * | + | * centisome position: |
− | ** | + | ** 63.445316 |
* Synonym(s): | * Synonym(s): | ||
+ | ** Esi_072_0131 | ||
+ | ** Esi072_0131 | ||
− | == | + | == Reactions associated == |
− | * [[RXN | + | * [[PROTEIN-KINASE-RXN]] |
− | + | ** esiliculosus_genome | |
− | * | + | ***go-term |
− | == | + | == Pathways associated == |
== External links == | == External links == | ||
− | + | {{#set: left end position=4682340}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=4684239}} | |
− | + | {{#set: centisome position=63.445316 }} | |
− | + | {{#set: common name=Esi_072_0131|Esi072_0131}} | |
− | + | {{#set: reaction associated=PROTEIN-KINASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 21:35, 17 March 2018
Gene Ec-21_003700
- left end position:
- 4682340
- transcription direction:
- POSITIVE
- right end position:
- 4684239
- centisome position:
- 63.445316
- Synonym(s):
- Esi_072_0131
- Esi072_0131
Reactions associated
- PROTEIN-KINASE-RXN
- esiliculosus_genome
- go-term
- esiliculosus_genome