Difference between revisions of "L-Galactopyranose"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRAZINOIC-ACID PYRAZINOIC-ACID] == * smiles: ** C1(N=CC=NC=1C([O-])=O) * inchi key: ** InChIKe...")
 
(Created page with "Category:Gene == Gene Ec-04_001960 == * left end position: ** 2160634 * transcription direction: ** POSITIVE * right end position: ** 2165021 * centisome position: ** 33.1...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRAZINOIC-ACID PYRAZINOIC-ACID] ==
+
== Gene Ec-04_001960 ==
−
* smiles:
+
* left end position:
−
** C1(N=CC=NC=1C([O-])=O)
+
** 2160634
−
* inchi key:
+
* transcription direction:
−
** InChIKey=NIPZZXUFJPQHNH-UHFFFAOYSA-M
+
** POSITIVE
−
* common name:
+
* right end position:
−
** pyrazine-2-carboxylate
+
** 2165021
−
* molecular weight:
+
* centisome position:
−
** 123.091    
+
** 33.180027    
 
* Synonym(s):
 
* Synonym(s):
−
** pyrazinoate
+
** Esi_0015_0088
−
** pyrazinoic acid
+
** Esi0015_0088
−
** pyrazinecarboxylic acid
+
** TTK
−
** pyrazinemonocarboxylic acid
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[PROTEIN-KINASE-RXN]]
−
* [[PYRAZIN-RXN]]
+
** esiliculosus_genome
−
== Reaction(s) of unknown directionality ==
+
***go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=2160634}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=3728869 3728869]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEMSPIDER:
+
{{#set: right end position=2165021}}
−
** [http://www.chemspider.com/Chemical-Structure.2959374.html 2959374]
+
{{#set: centisome position=33.180027   }}
−
* CHEBI:
+
{{#set: common name=Esi_0015_0088|Esi0015_0088|TTK}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71266 71266]
+
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
−
* NCI:
+
−
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=27192 27192]
+
−
{{#set: smiles=C1(N=CC=NC=1C([O-])=O)}}
+
−
{{#set: inchi key=InChIKey=NIPZZXUFJPQHNH-UHFFFAOYSA-M}}
+
−
{{#set: common name=pyrazine-2-carboxylate}}
+
−
{{#set: molecular weight=123.091   }}
+
−
{{#set: common name=pyrazinoate|pyrazinoic acid|pyrazinecarboxylic acid|pyrazinemonocarboxylic acid}}
+
−
{{#set: produced by=PYRAZIN-RXN}}
+

Revision as of 21:36, 17 March 2018

Gene Ec-04_001960

  • left end position:
    • 2160634
  • transcription direction:
    • POSITIVE
  • right end position:
    • 2165021
  • centisome position:
    • 33.180027
  • Synonym(s):
    • Esi_0015_0088
    • Esi0015_0088
    • TTK

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=L-Galactopyranose&oldid=13706"