Difference between revisions of "Ec-19 004330"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-02_006310 == * left end position: ** 6415550 * transcription direction: ** NEGATIVE * right end position: ** 6427020 * centisome position: ** 98.2...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15661 CPD-15661] == * smiles: ** CCCCCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15661 CPD-15661] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCCCCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=SZKPLUULGGERFD-MSNZEOPQSA-J |
| − | * | + | * common name: |
| − | ** | + | ** 2-trans, 4-trans-undecadienoyl-CoA |
| − | * | + | * molecular weight: |
| − | ** | + | ** 927.749 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 2E, 4E-undecadienoyl-CoA |
| − | + | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-14790]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-14789]] | |
| − | * [[RXN- | + | == Reaction(s) of unknown directionality == |
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658303 90658303] |
| − | {{#set: | + | {{#set: smiles=CCCCCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=SZKPLUULGGERFD-MSNZEOPQSA-J}} |
| − | {{#set: common name= | + | {{#set: common name=2-trans, 4-trans-undecadienoyl-CoA}} |
| − | {{#set: | + | {{#set: molecular weight=927.749 }} |
| − | {{#set: | + | {{#set: common name=2E, 4E-undecadienoyl-CoA}} |
| + | {{#set: consumed by=RXN-14790}} | ||
| + | {{#set: produced by=RXN-14789}} | ||
Revision as of 21:36, 17 March 2018
Contents
Metabolite CPD-15661
- smiles:
- CCCCCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=SZKPLUULGGERFD-MSNZEOPQSA-J
- common name:
- 2-trans, 4-trans-undecadienoyl-CoA
- molecular weight:
- 927.749
- Synonym(s):
- 2E, 4E-undecadienoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCCCCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
