Difference between revisions of "3OH-4P-OH-ALPHA-KETOBUTYRATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYL PHENYL] == * smiles: ** CC(=O)C1(C=CC=CC=1) * inchi key: ** InChIKey=KWOLFJPFCHCOCG-UHFF...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXY-CTP 5-HYDROXY-CTP] == * smiles: ** C(C2(C(C(O)C(N1(C(N=C(C(O)=C1)N)=O))O2)O))OP(OP(OP...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXY-CTP 5-HYDROXY-CTP] == |
* smiles: | * smiles: | ||
− | ** | + | ** C(C2(C(C(O)C(N1(C(N=C(C(O)=C1)N)=O))O2)O))OP(OP(OP([O-])([O-])=O)([O-])=O)([O-])=O |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=DMFODUNDODUQKK-UAKXSSHOSA-J |
* common name: | * common name: | ||
− | ** | + | ** 5-hydroxy-CTP |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 495.126 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 5-hydroxycytidine triphosphate |
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN0-7080]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202584 25202584] |
− | + | {{#set: smiles=C(C2(C(C(O)C(N1(C(N=C(C(O)=C1)N)=O))O2)O))OP(OP(OP([O-])([O-])=O)([O-])=O)([O-])=O}} | |
− | + | {{#set: inchi key=InChIKey=DMFODUNDODUQKK-UAKXSSHOSA-J}} | |
− | + | {{#set: common name=5-hydroxy-CTP}} | |
− | + | {{#set: molecular weight=495.126 }} | |
− | + | {{#set: common name=5-hydroxycytidine triphosphate}} | |
− | + | {{#set: produced by=RXN0-7080}} | |
− | + | ||
− | {{#set: smiles= | + | |
− | {{#set: inchi key=InChIKey= | + | |
− | {{#set: common name= | + | |
− | {{#set: molecular weight= | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 21:37, 17 March 2018
Contents
Metabolite 5-HYDROXY-CTP
- smiles:
- C(C2(C(C(O)C(N1(C(N=C(C(O)=C1)N)=O))O2)O))OP(OP(OP([O-])([O-])=O)([O-])=O)([O-])=O
- inchi key:
- InChIKey=DMFODUNDODUQKK-UAKXSSHOSA-J
- common name:
- 5-hydroxy-CTP
- molecular weight:
- 495.126
- Synonym(s):
- 5-hydroxycytidine triphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(C2(C(C(O)C(N1(C(N=C(C(O)=C1)N)=O))O2)O))OP(OP(OP([O-])([O-])=O)([O-])=O)([O-])=O" cannot be used as a page name in this wiki.