Difference between revisions of "Ox-Thioredoxin"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIVINYLCHLOROPHYLLIDE-A DIVINYLCHLOROPHYLLIDE-A] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=...")
 
(Created page with "Category:Gene == Gene Ec-15_004110 == * left end position: ** 4395867 * transcription direction: ** POSITIVE * right end position: ** 4400839 * centisome position: ** 81.4...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIVINYLCHLOROPHYLLIDE-A DIVINYLCHLOROPHYLLIDE-A] ==
+
== Gene Ec-15_004110 ==
−
* smiles:
+
* left end position:
−
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
+
** 4395867
−
* common name:
+
* transcription direction:
−
** 3,8-divinyl chlorophyllide a
+
** POSITIVE
−
* molecular weight:
+
* right end position:
−
** 610.951    
+
** 4400839
 +
* centisome position:
 +
** 81.43129    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0188_0005
 +
** Esi0188_0005
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[GLUTAMINESYN-RXN]]
−
* [[RXN-5285]]
+
** esiliculosus_genome
−
== Reaction(s) of unknown directionality ==
+
***ec-number
 +
** [[pantograph]]-[[aragem]]
 +
** [[pantograph]]-[[aragem]]
 +
** [[pantograph]]-[[aragem]]
 +
== Pathways associated ==
 +
* [[GLNSYN-PWY]]
 +
* [[PWY-5675]]
 +
* [[PWY-381]]
 +
* [[PWY-6549]]
 +
* [[PWY-6964]]
 +
* [[PWY490-3]]
 +
* [[PWY-6963]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=4395867}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=56927710 56927710]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEMSPIDER:
+
{{#set: right end position=4400839}}
−
** [http://www.chemspider.com/Chemical-Structure.391650.html 391650]
+
{{#set: centisome position=81.43129    }}
−
* CHEBI:
+
{{#set: common name=Esi_0188_0005|Esi0188_0005}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=38259 38259]
+
{{#set: reaction associated=GLUTAMINESYN-RXN}}
−
* LIGAND-CPD:
+
{{#set: pathway associated=GLNSYN-PWY|PWY-5675|PWY-381|PWY-6549|PWY-6964|PWY490-3|PWY-6963}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C11832 C11832]
+
−
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
+
−
{{#set: common name=3,8-divinyl chlorophyllide a}}
+
−
{{#set: molecular weight=610.951    }}
+
−
{{#set: produced by=RXN-5285}}
+

Revision as of 21:38, 17 March 2018

Gene Ec-15_004110

  • left end position:
    • 4395867
  • transcription direction:
    • POSITIVE
  • right end position:
    • 4400839
  • centisome position:
    • 81.43129
  • Synonym(s):
    • Esi_0188_0005
    • Esi0188_0005

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ox-Thioredoxin&oldid=13801"