Difference between revisions of "FADH2"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COUMARATE COUMARATE] == * smiles: ** C(=O)([O-])C=CC1(=CC=C(O)C=C1) * inchi key: ** InChIKey=NG...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Long-Chain-Aldehydes Long-Chain-Aldehydes] == * common name: ** a long-chain aldehyde * Synonym...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Long-Chain-Aldehydes Long-Chain-Aldehydes] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** a long-chain aldehyde |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** a long-chain fatty aldehyde |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[LONG-CHAIN-FATTY-ACYL-COA-REDUCTASE-RXN]] | ||
== External links == | == External links == | ||
− | + | {{#set: common name=a long-chain aldehyde}} | |
− | + | {{#set: common name=a long-chain fatty aldehyde}} | |
− | + | {{#set: reversible reaction associated=LONG-CHAIN-FATTY-ACYL-COA-REDUCTASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: common name= | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 22:38, 17 March 2018
Contents
Metabolite Long-Chain-Aldehydes
- common name:
- a long-chain aldehyde
- Synonym(s):
- a long-chain fatty aldehyde