Difference between revisions of "CD-S-SP-Complex"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12473 RXN-12473] == * direction: ** LEFT-TO-RIGHT * common name: ** molybdopterin-synthase aden...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-659 CPD-659] == * smiles: ** C(C(CC1(C=CC(C=C1)O)C([O-])=O)[N+])([O-])=O * common name: **...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12473 RXN-12473] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-659 CPD-659] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(C(CC1(C=CC(C=C1)O)C([O-])=O)[N+])([O-])=O
 
* common name:
 
* common name:
−
** molybdopterin-synthase adenylyltransferase / sulfurtransferase
+
** L-arogenate
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.8.1.11 EC-2.8.1.11]
+
** InChIKey=MIEILDYWGANZNH-DSQUFTABSA-M
 +
* molecular weight:
 +
** 226.208   
 
* Synonym(s):
 
* Synonym(s):
 +
** L-arogenic acid
 +
** pretyrosine
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[CYCLOHEXADIENYL-DEHYDROGENASE-RXN]]
−
** 1 [[L-Cysteine-Desulfurase-persulfide]][c] '''+''' 1 [[Donor-H2]][c] '''+''' 1 [[Carboxyadenylated-MPT-synthases]][c] '''=>''' 1 [[Acceptor]][c] '''+''' 1 [[Thiocarboxylated-MPT-synthases]][c] '''+''' 1 [[Cysteine-Desulfurase-L-cysteine]][c] '''+''' 1 [[AMP]][c] '''+''' 1 [[PROTON]][c]
+
* [[RXN-5682]]
−
* With common name(s):
+
== Reaction(s) known to produce the compound ==
−
** 1 an [L-cysteine desulfurase] L-cysteine persulfide[c] '''+''' 1 an reduced unknown electron acceptor[c] '''+''' 1 a carboxy-adenylated small subunit of molybdopterin synthase[c] '''=>''' 1 an oxidized unknown electron acceptor[c] '''+''' 1 a thiocarboxylated small subunit of molybdopterin synthase[c] '''+''' 1 an [L-cysteine desulfurase]-L-cysteine[c] '''+''' 1 AMP[c] '''+''' 1 H+[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
* [[RXN-14476]]
−
== Genes associated with this reaction  ==
+
* [[PREPHENATE-ASP-TRANSAMINE-RXN]]
−
Genes have been associated with this reaction based on different elements listed below.
+
* [[PREPHENATE-TRANSAMINE-RXN]]
−
* [[Ec-22_001380]]
+
−
** ESILICULOSUS_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
* [[PWY-6823]], molybdenum cofactor biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6823 PWY-6823]
+
−
** '''7''' reactions found over '''7''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CAS : 53078-86-7
−
{{#set: common name=molybdopterin-synthase adenylyltransferase / sulfurtransferase}}
+
* PUBCHEM:
−
{{#set: ec number=EC-2.8.1.11}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244469 25244469]
−
{{#set: gene associated=Ec-22_001380}}
+
* CHEBI:
−
{{#set: in pathway=PWY-6823}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58180 58180]
−
{{#set: reconstruction category=annotation}}
+
* LIGAND-CPD:
−
{{#set: reconstruction tool=pathwaytools}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C00826 C00826]
−
{{#set: reconstruction source=esiliculosus_genome}}
+
{{#set: smiles=C(C(CC1(C=CC(C=C1)O)C([O-])=O)[N+])([O-])=O}}
 +
{{#set: common name=L-arogenate}}
 +
{{#set: inchi key=InChIKey=MIEILDYWGANZNH-DSQUFTABSA-M}}
 +
{{#set: molecular weight=226.208    }}
 +
{{#set: common name=L-arogenic acid|pretyrosine}}
 +
{{#set: consumed by=CYCLOHEXADIENYL-DEHYDROGENASE-RXN|RXN-5682}}
 +
{{#set: reversible reaction associated=RXN-14476|PREPHENATE-ASP-TRANSAMINE-RXN|PREPHENATE-TRANSAMINE-RXN}}

Revision as of 21:38, 17 March 2018

Metabolite CPD-659

  • smiles:
    • C(C(CC1(C=CC(C=C1)O)C([O-])=O)[N+])([O-])=O
  • common name:
    • L-arogenate
  • inchi key:
    • InChIKey=MIEILDYWGANZNH-DSQUFTABSA-M
  • molecular weight:
    • 226.208
  • Synonym(s):
    • L-arogenic acid
    • pretyrosine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C(CC1(C=CC(C=C1)O)C([O-])=O)[N+])([O-])=O" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CD-S-SP-Complex&oldid=13861"