Difference between revisions of "TYROSINE--TRNA-LIGASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.3.1.179-RXN 2.3.1.179-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15654 CPD-15654] == * smiles: ** CCCCCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O...")
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.3.1.179-RXN 2.3.1.179-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15654 CPD-15654] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CCCCCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
* ec number:
+
* inchi key:
** [http://enzyme.expasy.org/EC/2.3.1.179 EC-2.3.1.179]
+
** InChIKey=SZKPLUULGGERFD-NFPSBOAPSA-J
 +
* common name:
 +
** 2-trans, 4-cis-undecadienoyl-CoA
 +
* molecular weight:
 +
** 927.749   
 
* Synonym(s):
 
* Synonym(s):
 +
** 2E, 4Z-undecadienoyl-CoA
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-14776]]
** 1 [[Palmitoleoyl-ACPs]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[MALONYL-ACP]][c] '''=>''' 1 [[ACP]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[3-oxo-cis-vaccenoyl-ACPs]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
* [[RXN-14775]]
** 1 a palmitoleoyl-[acp][c] '''+''' 1 H+[c] '''+''' 1 a malonyl-[acp][c] '''=>''' 1 a holo-[acyl-carrier protein][c] '''+''' 1 CO2[c] '''+''' 1 a 3-oxo-cis-vacc-11-enoyl-[acp][c]
+
== Reaction(s) of unknown directionality ==
 
+
== Genes associated with this reaction  ==
+
== Pathways  ==
+
* [[PWY-5973]], cis-vaccenate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5973 PWY-5973]
+
** '''5''' reactions found over '''5''' reactions in the full pathway
+
== Reconstruction information  ==
+
* [[gap-filling]]:
+
** [[meneco]]:
+
*** [[added for gapfilling]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
{{#set: ec number=EC-2.3.1.179}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658228 90658228]
{{#set: in pathway=PWY-5973}}
+
{{#set: smiles=CCCCCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
{{#set: reconstruction category=gap-filling}}
+
{{#set: inchi key=InChIKey=SZKPLUULGGERFD-NFPSBOAPSA-J}}
{{#set: reconstruction tool=meneco}}
+
{{#set: common name=2-trans, 4-cis-undecadienoyl-CoA}}
{{#set: reconstruction source=added for gapfilling}}
+
{{#set: molecular weight=927.749    }}
 +
{{#set: common name=2E, 4Z-undecadienoyl-CoA}}
 +
{{#set: consumed by=RXN-14776}}
 +
{{#set: produced by=RXN-14775}}

Revision as of 22:39, 17 March 2018

Metabolite CPD-15654

  • smiles:
    • CCCCCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • inchi key:
    • InChIKey=SZKPLUULGGERFD-NFPSBOAPSA-J
  • common name:
    • 2-trans, 4-cis-undecadienoyl-CoA
  • molecular weight:
    • 927.749
  • Synonym(s):
    • 2E, 4Z-undecadienoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.