Difference between revisions of "RXN-12730"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15675 CPD-15675] == * smiles: ** CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11409 RXN-11409] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15675 CPD-15675] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11409 RXN-11409] ==
* smiles:
+
* direction:
** CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=OOSDLBAXVXKFIB-BJBRNGJVSA-J
+
* common name:
+
** 2-trans-6-trans-tridecadienoyl-CoA
+
* molecular weight:
+
** 955.803   
+
 
* Synonym(s):
 
* Synonym(s):
** 2E, 6E-tridecadienoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-14785]]
+
** 2 [[CPD-12377]][c] '''+''' 1 [[GTP]][c] '''=>''' 1 [[CPD-12366]][c] '''+''' 1 [[WATER]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 2 hydroxyl radical[c] '''+''' 1 GTP[c] '''=>''' 1 8-oxo-GTP[c] '''+''' 1 H2O[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY-6502]], oxidized GTP and dGTP detoxification: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6502 PWY-6502]
 +
** '''2''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658431 90658431]
+
{{#set: in pathway=PWY-6502}}
{{#set: smiles=CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reconstruction category=annotation}}
{{#set: inchi key=InChIKey=OOSDLBAXVXKFIB-BJBRNGJVSA-J}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
{{#set: common name=2-trans-6-trans-tridecadienoyl-CoA}}
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: molecular weight=955.803    }}
+
{{#set: common name=2E, 6E-tridecadienoyl-CoA}}
+
{{#set: produced by=RXN-14785}}
+

Revision as of 21:39, 17 March 2018

Reaction RXN-11409

  • direction:
    • LEFT-TO-RIGHT
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 2 hydroxyl radical[c] + 1 GTP[c] => 1 8-oxo-GTP[c] + 1 H2O[c]

Genes associated with this reaction

Pathways

  • PWY-6502, oxidized GTP and dGTP detoxification: PWY-6502
    • 2 reactions found over 4 reactions in the full pathway

Reconstruction information

External links