Difference between revisions of "Ec-23 003760"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-659 CPD-659] == * smiles: ** C(C(CC1(C=CC(C=C1)O)C([O-])=O)[N+])([O-])=O * common name: **...") |
(Created page with "Category:Gene == Gene Ec-01_008450 == * left end position: ** 7186154 * transcription direction: ** NEGATIVE * right end position: ** 7191780 * centisome position: ** 69.6...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-01_008450 == |
− | * | + | * left end position: |
− | ** | + | ** 7186154 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 7191780 |
− | * | + | * centisome position: |
− | ** | + | ** 69.64114 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0002_0012 |
− | ** | + | ** Esi0002_0012 |
− | == | + | == Reactions associated == |
− | * [[ | + | * [[6PGLUCONDEHYDROG-RXN]] |
− | * [[RXN- | + | ** esiliculosus_genome |
− | + | ***go-term | |
− | == | + | * [[RXN-9952]] |
− | * [[ | + | ** esiliculosus_genome |
− | * [[ | + | ***go-term |
− | + | == Pathways associated == | |
+ | * [[P122-PWY]] | ||
+ | * [[OXIDATIVEPENT-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=7186154}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=7191780}} | |
− | + | {{#set: centisome position=69.64114 }} | |
− | + | {{#set: common name=Esi_0002_0012|Esi0002_0012}} | |
− | + | {{#set: reaction associated=6PGLUCONDEHYDROG-RXN|RXN-9952}} | |
− | + | {{#set: pathway associated=P122-PWY|OXIDATIVEPENT-PWY}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 21:39, 17 March 2018
Gene Ec-01_008450
- left end position:
- 7186154
- transcription direction:
- NEGATIVE
- right end position:
- 7191780
- centisome position:
- 69.64114
- Synonym(s):
- Esi_0002_0012
- Esi0002_0012
Reactions associated
- 6PGLUCONDEHYDROG-RXN
- esiliculosus_genome
- go-term
- esiliculosus_genome
- RXN-9952
- esiliculosus_genome
- go-term
- esiliculosus_genome