Difference between revisions of "HYDROXYMETHYLGLUTARYL-COA-LYASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9533 RXN-9533] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/2....")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15435 CPD-15435] == * smiles: ** CC(O)C(C([O-])=O)NC(=O)OP(OCC3(C(C(C(N2(C1(=C(C(=NC=N1)N)N...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9533 RXN-9533] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15435 CPD-15435] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(O)C(C([O-])=O)NC(=O)OP(OCC3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))([O-])=O
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.3.1.86 EC-2.3.1.86]
+
** InChIKey=GHLUPQUHEIJRCU-DWVDDHQFSA-L
−
** [http://enzyme.expasy.org/EC/2.3.1.85 EC-2.3.1.85]
+
* common name:
−
** [http://enzyme.expasy.org/EC/4.2.1.59 EC-4.2.1.59]
+
** L-threonylcarbamoyladenylate
 +
* molecular weight:
 +
** 490.322   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-14570]]
−
** 1 [[R-3-hydroxydodecanoyl-ACPs]][c] '''=>''' 1 [[Dodec-2-enoyl-ACPs]][c] '''+''' 1 [[WATER]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 a (3R)-3-hydroxydodecanoyl-[acp][c] '''=>''' 1 a (2E)-dodec-2-enoyl-[acp][c] '''+''' 1 H2O[c]
+
* [[RXN-14569]]
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
* [[PWY-5994]], palmitate biosynthesis I (animals and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5994 PWY-5994]
+
−
** '''20''' reactions found over '''31''' reactions in the full pathway
+
−
* [[PWY-5971]], palmitate biosynthesis II (bacteria and plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5971 PWY-5971]
+
−
** '''28''' reactions found over '''31''' reactions in the full pathway
+
−
* [[PWY-7664]], oleate biosynthesis IV (anaerobic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7664 PWY-7664]
+
−
** '''10''' reactions found over '''14''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[gap-filling]]:
+
−
** [[meneco]]:
+
−
*** [[added for gapfilling]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: ec number=EC-2.3.1.86}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71464565 71464565]
−
{{#set: ec number=EC-2.3.1.85}}
+
* CHEBI:
−
{{#set: ec number=EC-4.2.1.59}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73682 73682]
−
{{#set: in pathway=PWY-5994|PWY-5971|PWY-7664}}
+
{{#set: smiles=CC(O)C(C([O-])=O)NC(=O)OP(OCC3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))([O-])=O}}
−
{{#set: reconstruction category=gap-filling}}
+
{{#set: inchi key=InChIKey=GHLUPQUHEIJRCU-DWVDDHQFSA-L}}
−
{{#set: reconstruction tool=meneco}}
+
{{#set: common name=L-threonylcarbamoyladenylate}}
−
{{#set: reconstruction source=added for gapfilling}}
+
{{#set: molecular weight=490.322    }}
 +
{{#set: consumed by=RXN-14570}}
 +
{{#set: reversible reaction associated=RXN-14569}}

Revision as of 21:39, 17 March 2018

Metabolite CPD-15435

  • smiles:
    • CC(O)C(C([O-])=O)NC(=O)OP(OCC3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))([O-])=O
  • inchi key:
    • InChIKey=GHLUPQUHEIJRCU-DWVDDHQFSA-L
  • common name:
    • L-threonylcarbamoyladenylate
  • molecular weight:
    • 490.322
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(O)C(C([O-])=O)NC(=O)OP(OCC3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))([O-])=O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=HYDROXYMETHYLGLUTARYL-COA-LYASE-RXN&oldid=13907"