Difference between revisions of "RIBOFLAVINSYNDEAM-RXN"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.3.1.9-RXN 1.3.1.9-RXN] == * direction: ** REVERSIBLE * common name: ** Glucose/ribitol dehydrogen...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BENZOYLCOA BENZOYLCOA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C1(=CC=CC=C1))COP(=O)(OP...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BENZOYLCOA BENZOYLCOA] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C1(=CC=CC=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-] |
+ | * inchi key: | ||
+ | ** InChIKey=VEVJTUNLALKRNO-TYHXJLICSA-J | ||
* common name: | * common name: | ||
− | ** | + | ** benzoyl-CoA |
− | * | + | * molecular weight: |
− | ** | + | ** 867.61 |
* Synonym(s): | * Synonym(s): | ||
+ | ** S-benzoate coenzyme A | ||
+ | ** benzoyl-S-CoA | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-2006]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * LIGAND- | + | * CAS : 102185-37-5 |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | * PUBCHEM: |
− | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266596 45266596] | |
− | {{#set: | + | * CHEBI: |
− | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57369 57369] | |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00512 C00512] |
− | {{#set: | + | * HMDB : HMDB02252 |
− | {{#set: | + | {{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C1(=CC=CC=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=VEVJTUNLALKRNO-TYHXJLICSA-J}} |
+ | {{#set: common name=benzoyl-CoA}} | ||
+ | {{#set: molecular weight=867.61 }} | ||
+ | {{#set: common name=S-benzoate coenzyme A|benzoyl-S-CoA}} | ||
+ | {{#set: produced by=RXN-2006}} |
Revision as of 22:39, 17 March 2018
Contents
Metabolite BENZOYLCOA
- smiles:
- CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C1(=CC=CC=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
- inchi key:
- InChIKey=VEVJTUNLALKRNO-TYHXJLICSA-J
- common name:
- benzoyl-CoA
- molecular weight:
- 867.61
- Synonym(s):
- S-benzoate coenzyme A
- benzoyl-S-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C1(=CC=CC=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-" cannot be used as a page name in this wiki.