Difference between revisions of "RXN-7908"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLT GLT] == * smiles: ** C(CCC(C(=O)[O-])[N+])([O-])=O * inchi key: ** InChIKey=WHUUTDBJXJRKMK-...") |
(Created page with "Category:Gene == Gene Ec-00_008240 == * left end position: ** 13664741 * transcription direction: ** NEGATIVE * right end position: ** 13668762 * centisome position: ** 72...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-00_008240 == |
− | * | + | * left end position: |
− | ** | + | ** 13664741 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 13668762 |
− | * | + | * centisome position: |
− | ** | + | ** 72.12303 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0612_0005 |
− | ** | + | ** Esi0612_0005 |
− | ** | + | ** CAT |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[CATAL-RXN]] |
− | * | + | ** esiliculosus_genome |
− | * | + | ***ec-number |
− | * | + | * [[PEROXID-RXN]] |
− | * | + | ** esiliculosus_genome |
− | * | + | ***go-term |
− | * [[ | + | * [[RXN-14189]] |
− | * | + | ** esiliculosus_genome |
− | * | + | ***ec-number |
− | * | + | * [[RXN-14240]] |
− | * | + | ** esiliculosus_genome |
− | * | + | ***go-term |
− | * [[RXN- | + | * [[RXN-15288]] |
− | + | ** esiliculosus_genome | |
− | * | + | ***go-term |
− | * | + | * [[RXN-17352]] |
− | * | + | ** esiliculosus_genome |
− | * | + | ***go-term |
− | * | + | * [[RXN-8635]] |
− | * [[ | + | ** esiliculosus_genome |
− | + | ***go-term | |
− | * | + | * [[RXN66-1]] |
− | * | + | ** esiliculosus_genome |
− | * | + | ***ec-number |
− | * | + | == Pathways associated == |
− | * | + | * [[PWY-7214]] |
− | * [[ | + | * [[PWY-7445]] |
− | + | * [[PWY66-162]] | |
− | * | + | * [[DETOX1-PWY]] |
− | * | + | * [[PWY-6824]] |
− | + | * [[DETOX1-PWY-1]] | |
− | * | + | * [[PWY-5469]] |
− | * | + | * [[PWY-5506]] |
− | * [[RXN- | + | * [[PWY-5466]] |
− | * | + | * [[PWY-5461]] |
− | * | + | |
− | * | + | |
− | * | + | |
− | * | + | |
− | * [[ | + | |
− | + | ||
− | * | + | |
− | * | + | |
− | * | + | |
− | * | + | |
− | * | + | |
− | * [[ | + | |
− | * | + | |
− | * | + | |
− | * | + | |
− | * | + | |
− | * | + | |
− | + | ||
− | * [[ | + | |
− | * [[ | + | |
− | * [[ | + | |
− | * [[ | + | |
− | * [[ | + | |
− | * [[ | + | |
− | * [[ | + | |
− | * [[ | + | |
− | * [[ | + | |
− | * [[ | + | |
== External links == | == External links == | ||
− | + | {{#set: left end position=13664741}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=13668762}} | |
− | + | {{#set: centisome position=72.12303 }} | |
− | + | {{#set: common name=Esi_0612_0005|Esi0612_0005|CAT}} | |
− | + | {{#set: reaction associated=CATAL-RXN|PEROXID-RXN|RXN-14189|RXN-14240|RXN-15288|RXN-17352|RXN-8635|RXN66-1}} | |
− | + | {{#set: pathway associated=PWY-7214|PWY-7445|PWY66-162|DETOX1-PWY|PWY-6824|DETOX1-PWY-1|PWY-5469|PWY-5506|PWY-5466|PWY-5461}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Revision as of 20:29, 17 March 2018
Gene Ec-00_008240
- left end position:
- 13664741
- transcription direction:
- NEGATIVE
- right end position:
- 13668762
- centisome position:
- 72.12303
- Synonym(s):
- Esi_0612_0005
- Esi0612_0005
- CAT
Reactions associated
- CATAL-RXN
- esiliculosus_genome
- ec-number
- esiliculosus_genome
- PEROXID-RXN
- esiliculosus_genome
- go-term
- esiliculosus_genome
- RXN-14189
- esiliculosus_genome
- ec-number
- esiliculosus_genome
- RXN-14240
- esiliculosus_genome
- go-term
- esiliculosus_genome
- RXN-15288
- esiliculosus_genome
- go-term
- esiliculosus_genome
- RXN-17352
- esiliculosus_genome
- go-term
- esiliculosus_genome
- RXN-8635
- esiliculosus_genome
- go-term
- esiliculosus_genome
- RXN66-1
- esiliculosus_genome
- ec-number
- esiliculosus_genome