Difference between revisions of "CREATINE-P"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMIDAZOLE-ACETOL-P IMIDAZOLE-ACETOL-P] == * smiles: ** C1(NC=NC=1CC(COP([O-])(=O)[O-])=O) * inc...") |
(Created page with "Category:Gene == Gene Ec-16_000240 == * left end position: ** 225366 * transcription direction: ** NEGATIVE * right end position: ** 234541 * centisome position: ** 4.2221...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-16_000240 == |
− | * | + | * left end position: |
− | ** | + | ** 225366 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 234541 |
− | * | + | * centisome position: |
− | ** | + | ** 4.222192 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0095_0043 |
− | ** | + | ** Esi0095_0043 |
− | == | + | == Reactions associated == |
− | * [[ | + | * [[PEROXID-RXN]] |
− | + | ** esiliculosus_genome | |
− | * [[ | + | ***go-term |
− | == | + | * [[RXN-14240]] |
+ | ** esiliculosus_genome | ||
+ | ***go-term | ||
+ | * [[RXN-15288]] | ||
+ | ** esiliculosus_genome | ||
+ | ***go-term | ||
+ | * [[RXN-17352]] | ||
+ | ** esiliculosus_genome | ||
+ | ***go-term | ||
+ | * [[RXN-8635]] | ||
+ | ** esiliculosus_genome | ||
+ | ***go-term | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7214]] | ||
+ | * [[PWY-6824]] | ||
+ | * [[PWY-7445]] | ||
+ | * [[PWY-5469]] | ||
+ | * [[PWY-5466]] | ||
+ | * [[PWY-5461]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=225366}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=234541}} | |
− | + | {{#set: centisome position=4.222192 }} | |
− | + | {{#set: common name=Esi_0095_0043|Esi0095_0043}} | |
− | + | {{#set: reaction associated=PEROXID-RXN|RXN-14240|RXN-15288|RXN-17352|RXN-8635}} | |
− | + | {{#set: pathway associated=PWY-7214|PWY-6824|PWY-7445|PWY-5469|PWY-5466|PWY-5461}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 21:41, 17 March 2018
Gene Ec-16_000240
- left end position:
- 225366
- transcription direction:
- NEGATIVE
- right end position:
- 234541
- centisome position:
- 4.222192
- Synonym(s):
- Esi_0095_0043
- Esi0095_0043
Reactions associated
- PEROXID-RXN
- esiliculosus_genome
- go-term
- esiliculosus_genome
- RXN-14240
- esiliculosus_genome
- go-term
- esiliculosus_genome
- RXN-15288
- esiliculosus_genome
- go-term
- esiliculosus_genome
- RXN-17352
- esiliculosus_genome
- go-term
- esiliculosus_genome
- RXN-8635
- esiliculosus_genome
- go-term
- esiliculosus_genome