Difference between revisions of "RXN-4210"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYLTRANSFER-RXN N-ACETYLTRANSFER-RXN] == * direction: ** REVERSIBLE * common name: ** Amino-ac...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-713 CPD-713] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYLTRANSFER-RXN N-ACETYLTRANSFER-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-713 CPD-713] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
 +
* inchi key:
 +
** InChIKey=NBJZGNFIZZWBOJ-JSHJXQBASA-N
 
* common name:
 
* common name:
−
** Amino-acid N-acetyltransferase
+
** 6-oxocampestanol
−
** Arginine biosynthesis bifunctional protein ArgJ
+
* molecular weight:
−
* ec number:
+
** 416.686   
−
** [http://enzyme.expasy.org/EC/2.3.1.1 EC-2.3.1.1]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** oxocampestanol
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-715]]
−
** 1 [[GLT]][c] '''+''' 1 [[ACETYL-COA]][c] '''<=>''' 1 [[ACETYL-GLU]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[CO-A]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 L-glutamate[c] '''+''' 1 acetyl-CoA[c] '''<=>''' 1 N-acetyl-L-glutamate[c] '''+''' 1 H+[c] '''+''' 1 coenzyme A[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-14_006230]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
* [[Ec-07_005560]]
+
−
** ESILICULOSUS_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
** [[pantograph]]-[[aragem]]
+
−
== Pathways  ==
+
−
* [[PWY-5154]], L-arginine biosynthesis III (via N-acetyl-L-citrulline): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5154 PWY-5154]
+
−
** '''7''' reactions found over '''9''' reactions in the full pathway
+
−
* [[GLUTORN-PWY]], L-ornithine biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=GLUTORN-PWY GLUTORN-PWY]
+
−
** '''5''' reactions found over '''5''' reactions in the full pathway
+
−
* [[ARGSYNBSUB-PWY]], L-arginine biosynthesis II (acetyl cycle): [http://metacyc.org/META/NEW-IMAGE?object=ARGSYNBSUB-PWY ARGSYNBSUB-PWY]
+
−
** '''9''' reactions found over '''9''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[aragem]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=24292 24292]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200917 25200917]
−
* LIGAND-RXN:
+
* LIGAND-CPD:
−
** [http://www.genome.jp/dbget-bin/www_bget?R00259 R00259]
+
** [http://www.genome.jp/dbget-bin/www_bget?C15789 C15789]
−
* UNIPROT:
+
{{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
−
** [http://www.uniprot.org/uniprot/Q9JW21 Q9JW21]
+
{{#set: inchi key=InChIKey=NBJZGNFIZZWBOJ-JSHJXQBASA-N}}
−
** [http://www.uniprot.org/uniprot/P63574 P63574]
+
{{#set: common name=6-oxocampestanol}}
−
** [http://www.uniprot.org/uniprot/Q12643 Q12643]
+
{{#set: molecular weight=416.686    }}
−
** [http://www.uniprot.org/uniprot/P0A6C5 P0A6C5]
+
{{#set: common name=oxocampestanol}}
−
{{#set: direction=REVERSIBLE}}
+
{{#set: consumed by=RXN-715}}
−
{{#set: common name=Amino-acid N-acetyltransferase}}
+
−
{{#set: common name=Arginine biosynthesis bifunctional protein ArgJ}}
+
−
{{#set: ec number=EC-2.3.1.1}}
+
−
{{#set: gene associated=Ec-14_006230|Ec-07_005560}}
+
−
{{#set: in pathway=PWY-5154|GLUTORN-PWY|ARGSYNBSUB-PWY}}
+
−
{{#set: reconstruction category=orthology}}
+
−
{{#set: reconstruction tool=pantograph}}
+
−
{{#set: reconstruction source=aragem}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=esiliculosus_genome}}
+

Revision as of 21:41, 17 March 2018

Metabolite CPD-713

  • smiles:
    • CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • inchi key:
    • InChIKey=NBJZGNFIZZWBOJ-JSHJXQBASA-N
  • common name:
    • 6-oxocampestanol
  • molecular weight:
    • 416.686
  • Synonym(s):
    • oxocampestanol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-4210&oldid=14034"