Difference between revisions of "2E-9Z-octadeca-2-9-dienoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-OXOPIMELOYL-COA 3-OXOPIMELOYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCCC([O-])...")
 
(Created page with "Category:Gene == Gene Ec-00_001300 == * left end position: ** 1548233 * transcription direction: ** POSITIVE * right end position: ** 1559191 * centisome position: ** 8.17...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-OXOPIMELOYL-COA 3-OXOPIMELOYL-COA] ==
+
== Gene Ec-00_001300 ==
−
* smiles:
+
* left end position:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCCC([O-])=O)=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 1548233
−
* inchi key:
+
* transcription direction:
−
** InChIKey=KJXFOFKTZDJLMQ-UYRKPTJQSA-I
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 3-oxopimeloyl-CoA
+
** 1559191
−
* molecular weight:
+
* centisome position:
−
** 918.632    
+
** 8.171634    
 
* Synonym(s):
 
* Synonym(s):
−
** 3-oxopimelyl-CoA
+
** Esi_0013_0077
−
** 3-ketopimeloyl-CoA
+
** Esi0013_0077
−
** 3-ketopimelyl-CoA
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[DOLICHOL-KINASE-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** esiliculosus_genome
−
* [[RXN-8032]]
+
***go-term
 +
== Pathways associated ==
 +
* [[PWY-6129]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=1548233}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266579 45266579]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=1559191}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57350 57350]
+
{{#set: centisome position=8.171634   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0013_0077|Esi0013_0077}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06715 C06715]
+
{{#set: reaction associated=DOLICHOL-KINASE-RXN}}
−
* HMDB : HMDB12158
+
{{#set: pathway associated=PWY-6129}}
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCCC([O-])=O)=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=KJXFOFKTZDJLMQ-UYRKPTJQSA-I}}
+
−
{{#set: common name=3-oxopimeloyl-CoA}}
+
−
{{#set: molecular weight=918.632   }}
+
−
{{#set: common name=3-oxopimelyl-CoA|3-ketopimeloyl-CoA|3-ketopimelyl-CoA}}
+
−
{{#set: consumed or produced by=RXN-8032}}
+

Revision as of 21:41, 17 March 2018

Gene Ec-00_001300

  • left end position:
    • 1548233
  • transcription direction:
    • POSITIVE
  • right end position:
    • 1559191
  • centisome position:
    • 8.171634
  • Synonym(s):
    • Esi_0013_0077
    • Esi0013_0077

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=2E-9Z-octadeca-2-9-dienoyl-ACPs&oldid=14036"