Difference between revisions of "DXS-RXN"

Revision as of 21:41, 17 March 2018

"C(C(=O)[O-])C(O)[CH]=O" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
-[[Category:Gene]]
+[[Category:Metabolite]]
-== Gene Ec-16_000930 ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16618 CPD-16618] ==
-* left end position:
+* smiles:
-** 1008434
+** C(C(=O)[O-])C(O)[CH]=O
-* transcription direction:
+* inchi key:
-** POSITIVE
+** InChIKey=QWHDXIUUXWGQME-GSVOUGTGSA-M
-* right end position:
+* common name:
-** 1021959
+** L-malic semialdehyde
-* centisome position:
+* molecular weight:
-** 18.892832
+** 117.081
 * Synonym(s):
-** Esi_0205_0014
+** (3R)-3-hydroxy-4-oxobutanoate
-** Esi0205_0014
-== Reactions associated ==
+== Reaction(s) known to consume the compound ==
-* [[ATPASE-RXN]]
+* [[RXN-6002]]
-** esiliculosus_genome
+== Reaction(s) known to produce the compound ==
-***go-term
+== Reaction(s) of unknown directionality ==
-== Pathways associated ==
 == External links  ==
-{{#set: left end position=1008434}}
+* PUBCHEM:
-{{#set: transcription direction=POSITIVE}}
+** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658049 90658049]
-{{#set: right end position=1021959}}
+{{#set: smiles=C(C(=O)[O-])C(O)[CH]=O}}
-{{#set: centisome position=18.892832    }}
+{{#set: inchi key=InChIKey=QWHDXIUUXWGQME-GSVOUGTGSA-M}}
-{{#set: common name=Esi_0205_0014|Esi0205_0014}}
+{{#set: common name=L-malic semialdehyde}}
-{{#set: reaction associated=ATPASE-RXN}}
+{{#set: molecular weight=117.081    }}
+{{#set: common name=(3R)-3-hydroxy-4-oxobutanoate}}
+{{#set: consumed by=RXN-6002}}