Difference between revisions of "3-oxo-dodecanoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16618 CPD-16618] == * smiles: ** C(C(=O)[O-])C(O)[CH]=O * inchi key: ** InChIKey=QWHDXIUUXW...")
 
(Created page with "Category:Gene == Gene Ec-01_006380 == * left end position: ** 5515049 * transcription direction: ** NEGATIVE * right end position: ** 5531315 * centisome position: ** 53.4...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16618 CPD-16618] ==
+
== Gene Ec-01_006380 ==
−
* smiles:
+
* left end position:
−
** C(C(=O)[O-])C(O)[CH]=O
+
** 5515049
−
* inchi key:
+
* transcription direction:
−
** InChIKey=QWHDXIUUXWGQME-GSVOUGTGSA-M
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** L-malic semialdehyde
+
** 5531315
−
* molecular weight:
+
* centisome position:
−
** 117.081    
+
** 53.446434    
 
* Synonym(s):
 
* Synonym(s):
−
** (3R)-3-hydroxy-4-oxobutanoate
+
** Esi_0002_0315
 +
** Esi0002_0315
 +
** ADK
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-6002]]
+
* [[ADENYL-KIN-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** esiliculosus_genome
−
== Reaction(s) of unknown directionality ==
+
***ec-number
 +
** [[pantograph]]-[[aragem]]
 +
== Pathways associated ==
 +
* [[PWY-7219]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=5515049}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658049 90658049]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=C(C(=O)[O-])C(O)[CH]=O}}
+
{{#set: right end position=5531315}}
−
{{#set: inchi key=InChIKey=QWHDXIUUXWGQME-GSVOUGTGSA-M}}
+
{{#set: centisome position=53.446434   }}
−
{{#set: common name=L-malic semialdehyde}}
+
{{#set: common name=Esi_0002_0315|Esi0002_0315|ADK}}
−
{{#set: molecular weight=117.081   }}
+
{{#set: reaction associated=ADENYL-KIN-RXN}}
−
{{#set: common name=(3R)-3-hydroxy-4-oxobutanoate}}
+
{{#set: pathway associated=PWY-7219}}
−
{{#set: consumed by=RXN-6002}}
+

Revision as of 22:42, 17 March 2018

Gene Ec-01_006380

  • left end position:
    • 5515049
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 5531315
  • centisome position:
    • 53.446434
  • Synonym(s):
    • Esi_0002_0315
    • Esi0002_0315
    • ADK

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=3-oxo-dodecanoyl-ACPs&oldid=14106"