Difference between revisions of "Ec-09 002410"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-4157 RXN3O-4157] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/2...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18666 CPD-18666] == * smiles: ** CCC1(=C(C)C3(=NC1=CC6(=C(C)C7(C(=O)[C-](C(OC)=O)C(=C2(C(CC...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-4157 RXN3O-4157] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18666 CPD-18666] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** CCC1(=C(C)C3(=NC1=CC6(=C(C)C7(C(=O)[C-](C(OC)=O)C(=C2(C(CCC(=O)[O-])C(C)C(=N2)C=C5(C(C)=C(C=C)C4(OC34)(N5))))C(N6)=7))))
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.6.1.58 EC-2.6.1.58]
+
** InChIKey=ZMTPZDVBGYNPLZ-YGOWEZGDSA-M
 +
* common name:
 +
** epoxypheophorbide a
 +
* molecular weight:
 +
** 606.677   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-17253]]
−
** 1 [[TYR]][c] '''+''' 1 [[PYRUVATE]][c] '''<=>''' 1 [[L-ALPHA-ALANINE]][c] '''+''' 1 [[P-HYDROXY-PHENYLPYRUVATE]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-17252]]
−
** 1 L-tyrosine[c] '''+''' 1 pyruvate[c] '''<=>''' 1 L-alanine[c] '''+''' 1 4-hydroxyphenylpyruvate[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
* [[PWY3O-4108]], L-tyrosine degradation III: [http://metacyc.org/META/NEW-IMAGE?object=PWY3O-4108 PWY3O-4108]
+
−
** '''2''' reactions found over '''4''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[gap-filling]]:
+
−
** [[meneco]]:
+
−
*** [[added for gapfilling]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
{{#set: smiles=CCC1(=C(C)C3(=NC1=CC6(=C(C)C7(C(=O)[C-](C(OC)=O)C(=C2(C(CCC(=O)[O-])C(C)C(=N2)C=C5(C(C)=C(C=C)C4(OC34)(N5))))C(N6)=7))))}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R09254 R09254]
+
{{#set: inchi key=InChIKey=ZMTPZDVBGYNPLZ-YGOWEZGDSA-M}}
−
{{#set: direction=REVERSIBLE}}
+
{{#set: common name=epoxypheophorbide a}}
−
{{#set: ec number=EC-2.6.1.58}}
+
{{#set: molecular weight=606.677    }}
−
{{#set: in pathway=PWY3O-4108}}
+
{{#set: consumed by=RXN-17253}}
−
{{#set: reconstruction category=gap-filling}}
+
{{#set: produced by=RXN-17252}}
−
{{#set: reconstruction tool=meneco}}
+
−
{{#set: reconstruction source=added for gapfilling}}
+

Revision as of 21:42, 17 March 2018

Metabolite CPD-18666

  • smiles:
    • CCC1(=C(C)C3(=NC1=CC6(=C(C)C7(C(=O)[C-](C(OC)=O)C(=C2(C(CCC(=O)[O-])C(C)C(=N2)C=C5(C(C)=C(C=C)C4(OC34)(N5))))C(N6)=7))))
  • inchi key:
    • InChIKey=ZMTPZDVBGYNPLZ-YGOWEZGDSA-M
  • common name:
    • epoxypheophorbide a
  • molecular weight:
    • 606.677
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCC1(=C(C)C3(=NC1=CC6(=C(C)C7(C(=O)[C-](C(OC)=O)C(=C2(C(CCC(=O)[O-])C(C)C(=N2)C=C5(C(C)=C(C=C)C4(OC34)(N5))))C(N6)=7))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-09_002410&oldid=14145"