Difference between revisions of "PEPSYNTH-RXN"

Revision as of 21:43, 17 March 2018

@@ Line 1: / Line 1: @@
-[[Category:Metabolite]]
+[[Category:Gene]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18761 CPD-18761] ==
+== Gene Ec-25_002630 ==
-* smiles:
+* left end position:
-** COC1(=CC(=CCCO)C=CC(=O)1)
+** 2950737
-* inchi key:
+* transcription direction:
-** InChIKey=ORAJWSYKRGVTDP-UHFFFAOYSA-N
+** POSITIVE
-* common name:
+* right end position:
-** coniferyl alcohol radical
+** 2953929
-* molecular weight:
+* centisome position:
-** 179.195
+** 66.29472
 * Synonym(s):
+** Esi_0108_0001
+** Esi0108_0001
-== Reaction(s) known to consume the compound ==
+== Reactions associated ==
-== Reaction(s) known to produce the compound ==
+* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
-* [[RXN-17352]]
+** esiliculosus_genome
-== Reaction(s) of unknown directionality ==
+***go-term
+== Pathways associated ==
+* [[PWY-7511]]
 == External links  ==
-{{#set: smiles=COC1(=CC(=CCCO)C=CC(=O)1)}}
+{{#set: left end position=2950737}}
-{{#set: inchi key=InChIKey=ORAJWSYKRGVTDP-UHFFFAOYSA-N}}
+{{#set: transcription direction=POSITIVE}}
-{{#set: common name=coniferyl alcohol radical}}
+{{#set: right end position=2953929}}
-{{#set: molecular weight=179.195    }}
+{{#set: centisome position=66.29472    }}
-{{#set: produced by=RXN-17352}}
+{{#set: common name=Esi_0108_0001|Esi0108_0001}}
+{{#set: reaction associated=UBIQUITIN--PROTEIN-LIGASE-RXN}}
+{{#set: pathway associated=PWY-7511}}