Difference between revisions of "PEPSYNTH-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18761 CPD-18761] == * smiles: ** COC1(=CC(=CCCO)C=CC(=O)1) * inchi key: ** InChIKey=ORAJWSY...") |
(Created page with "Category:Gene == Gene Ec-25_002630 == * left end position: ** 2950737 * transcription direction: ** POSITIVE * right end position: ** 2953929 * centisome position: ** 66.2...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-25_002630 == |
− | * | + | * left end position: |
− | ** | + | ** 2950737 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 2953929 |
− | * | + | * centisome position: |
− | ** | + | ** 66.29472 |
* Synonym(s): | * Synonym(s): | ||
+ | ** Esi_0108_0001 | ||
+ | ** Esi0108_0001 | ||
− | == | + | == Reactions associated == |
− | + | * [[UBIQUITIN--PROTEIN-LIGASE-RXN]] | |
− | * [[ | + | ** esiliculosus_genome |
− | == | + | ***go-term |
+ | == Pathways associated == | ||
+ | * [[PWY-7511]] | ||
== External links == | == External links == | ||
− | {{#set: | + | {{#set: left end position=2950737}} |
− | {{#set: | + | {{#set: transcription direction=POSITIVE}} |
− | {{#set: common name= | + | {{#set: right end position=2953929}} |
− | {{#set: | + | {{#set: centisome position=66.29472 }} |
− | {{#set: | + | {{#set: common name=Esi_0108_0001|Esi0108_0001}} |
+ | {{#set: reaction associated=UBIQUITIN--PROTEIN-LIGASE-RXN}} | ||
+ | {{#set: pathway associated=PWY-7511}} |
Revision as of 21:43, 17 March 2018
Gene Ec-25_002630
- left end position:
- 2950737
- transcription direction:
- POSITIVE
- right end position:
- 2953929
- centisome position:
- 66.29472
- Synonym(s):
- Esi_0108_0001
- Esi0108_0001
Reactions associated
- UBIQUITIN--PROTEIN-LIGASE-RXN
- esiliculosus_genome
- go-term
- esiliculosus_genome