Difference between revisions of "RXN-13415"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE-5P SHIKIMATE-5P] == * smiles: ** C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1) * inc...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6983 PWY-6983] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-68336 TAX-6...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6983 PWY-6983] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-68336 TAX-68336] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-1117] |
− | * | + | |
* common name: | * common name: | ||
− | ** | + | ** tetrahydrobiopterin biosynthesis III |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''2''' reactions found over '''3''' reactions in the full pathway | |
− | + | * [[4.2.3.12-RXN]] | |
− | * [[ | + | ** 2 associated gene(s): |
− | * [[ | + | *** [[Ec-10_002190]] |
+ | *** [[Ec-27_003470]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[GTP-CYCLOHYDRO-I-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-27_007000]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13030 RXN-13030] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-68336}} | |
− | + | {{#set: taxonomic range=TAX-1117}} | |
− | + | {{#set: common name=tetrahydrobiopterin biosynthesis III}} | |
− | + | {{#set: reaction found=2}} | |
− | + | {{#set: total reaction=3}} | |
− | + | {{#set: completion rate=67.0}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 21:30, 17 March 2018
Pathway PWY-6983
Reaction(s) found
2 reactions found over 3 reactions in the full pathway
- 4.2.3.12-RXN
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
- GTP-CYCLOHYDRO-I-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated: